- Neomangiferin
-
- $57.00 / 1mL
-
2026-01-29
- CAS:64809-67-2
- Min. Order:
- Purity: 99.83%
- Supply Ability: 10g
- Neomangiferin
-
- $0.00 / 20mg
-
2023-02-24
- CAS:64809-67-2
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Neomangiferin
-
- $7.00 / 1KG
-
2020-02-19
- CAS:64809-67-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | Neomangiferin Basic information |
| Product Name: | Neomangiferin | | Synonyms: | 9H-Xanthen-9-one,2-β-D-glucopyranosyl-7-(β-D-glucopyranosyloxy)-1,3,6-trihydroxy-;2-beta-d-glucopyranosyl-7-(b-d-glucopyranosyloxy)-1,3,6-trihydroxy-9h-xanthen-9-one;Neomangiferin;eoMangiferin;Mangiferin 7-glucoside;1,3,6-Trihydroxy-2-((2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)-7-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-9H-xanthen-9-one;Neomangiferin-RM;Neomangiferin, 10 mM in DMSO | | CAS: | 64809-67-2 | | MF: | C25H28O16 | | MW: | 584.48 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;The group of Anemarrhenae | | Mol File: | 64809-67-2.mol |  |
| | Neomangiferin Chemical Properties |
| Boiling point | 1026.4±65.0 °C(Predicted) | | density | 1.839 | | solubility | Soluble in chloroform and methan | | pka | 6.10±0.20(Predicted) | | form | powder | | color | Ochre | | Major Application | food and beverages | | InChIKey | VUWOVGXVRYBSGI-UHFFFAOYSA-N | | SMILES | O1C(C(C(C(C1CO)O)O)O)Oc2cc3c(cc2O)Oc4c(c(c(c(c4)O)C5OC(C(C(C5O)O)O)CO)O)C3=O |
| WGK Germany | WGK 3 | | HS Code | 29389090 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral |
| | Neomangiferin Usage And Synthesis |
| Chemical Properties | Pale yellow powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from mango leaves and Anemarrhena asphodeloides. | | Uses | Neomangiferin is a xanthone glycoside that can be isolated from the Chinese medicinal herb Rhizoma Anemarrhenae. |
| | Neomangiferin Preparation Products And Raw materials |
|