| Company Name: |
TOSUN PHARM
|
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
| Products Intro: |
Product Name:Retinol impurity 1
CAS:35031-06-2
Purity:98%以上 Package:10mg;50mg;100mg等多种规格 Remarks:REF-R38001
|
| Company Name: |
Hubei Xinyang Medical Technology Co., Ltd
|
| Tel: |
15347293736 |
| Email: |
2853117764@yongstandards.com |
| Products Intro: |
Product Name:(Z)-4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-3-buten-2-one
CAS:35031-06-2
Purity:99% HPLC Package:10mg;25mg;50mg;100mg;200mg;500mg
|
| Company Name: |
Henan Vcommend Consultrading Co., Ltd.
|
| Tel: |
13393721940 |
| Email: |
sales@vcommend.com |
| Products Intro: |
Product Name:Ionone Impurity 3
CAS:35031-06-2
Purity:95.0% Package:10mg;20mg;50mg
|
|
| | (Z)-4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-3-buten-2-one Basic information |
| Product Name: | (Z)-4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-3-buten-2-one | | Synonyms: | (Z)-4-(2,6,6-Trimethyl-1-cyclohexenyl)-3-buten-2-one;(Z)-β-Ionoine;3-Buten-2-one, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (3Z)-;Vitamin A Impurity 20;Thioctic Acid Impurity 67;Ionone Impurity 3;(Z)-4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-3-buten-2-one | | CAS: | 35031-06-2 | | MF: | C13H20O | | MW: | 192.3 | | EINECS: | 252-325-4 | | Product Categories: | | | Mol File: | 35031-06-2.mol |  |
| | (Z)-4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-3-buten-2-one Chemical Properties |
| InChI | InChI=1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8H,5-6,9H2,1-4H3/b8-7- | | InChIKey | PSQYTAPXSHCGMF-FPLPWBNLSA-N | | SMILES | CC(=O)/C=C\C1C(C)(C)CCCC=1C | | LogP | 3.589 (est) |
| | (Z)-4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-3-buten-2-one Usage And Synthesis |
| | (Z)-4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-3-buten-2-one Preparation Products And Raw materials |
|