| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | bis(D-gluconato-O1,O2)nickel Basic information |
| Product Name: | bis(D-gluconato-O1,O2)nickel | | Synonyms: | bis(D-gluconato-O1,O2)nickel;Nickel Gluconate 71957-07-8;nickel(2+),(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate;NICKEL GLUCONATE | | CAS: | 71957-07-8 | | MF: | C12H20NiO14 | | MW: | 446.97 | | EINECS: | 276-205-6 | | Product Categories: | | | Mol File: | 71957-07-8.mol |  |
| | bis(D-gluconato-O1,O2)nickel Chemical Properties |
| InChI | InChI=1S/2C6H11O7.Ni/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-10H,1H2,(H,12,13);/q2*-1;+4/p-2 | | InChIKey | PZJPVIQXWIXRIR-UHFFFAOYSA-L | | SMILES | C(C1C([O-][Ni+2]2([O-]C(=O)C(C(O)C(O)C(O)CO)O2)O1)=O)(O)C(O)C(O)CO |
| | bis(D-gluconato-O1,O2)nickel Usage And Synthesis |
| | bis(D-gluconato-O1,O2)nickel Preparation Products And Raw materials |
|