| Company Name: |
Henan Lavoisier Chemical Products Co. Ltd Gold
|
| Tel: |
0371-63682289 18625781376 |
| Email: |
sales@lavoisier.cn |
| Products Intro: |
Product Name:1-(4-chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene
CAS:322-75-8
Purity:98% Package:1g/;5g/;10g/;25g/;50g/;100g/;500g/;1kg/
|
| Company Name: |
Zhengzhou Alfachem Co., Ltd.
|
| Tel: |
0371-53765687 18937137882 |
| Email: |
3969243885@qq.com |
| Products Intro: |
Product Name:1-(4-chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene
CAS:322-75-8
Purity:98% Package:1g
|
| Company Name: |
Henan Lien Chemical Products Co., Ltd.
|
| Tel: |
03716091-9097 13383857418 |
| Email: |
1520689222@qq.com |
| Products Intro: |
CAS:322-75-8
Purity:98% Package:5g/;10g/;25g/;50g/;100g/;250g/;500g/
|
| Company Name: |
Zhengzhou Edward Biology Co.,Ltd
|
| Tel: |
0371-63682289 15538176268 |
| Email: |
jacschem@163.com |
| Products Intro: |
Product Name:1-(4-chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene
CAS:322-75-8
Purity:0.98 Package:1g 5g 10g 25g 50g 100g 500g 1kg
|
|
| | 1-(4-chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene Basic information | | Uses |
| | 1-(4-chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene Chemical Properties |
| Melting point | 47 °C | | Boiling point | 126-138 °C(Press: 0.002 Torr) | | density | 1.461±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C13H7ClF3NO3/c14-9-2-4-10(5-3-9)21-12-6-1-8(13(15,16)17)7-11(12)18(19)20/h1-7H | | InChIKey | GZFYZMCWQKTEEW-UHFFFAOYSA-N | | SMILES | C1(OC2=CC=C(Cl)C=C2)=CC=C(C(F)(F)F)C=C1[N+]([O-])=O |
| | 1-(4-chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene Usage And Synthesis |
| Uses | 1-(4-Chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene is used as a research compound and in organic synthesis, etc. |
| | 1-(4-chlorophenoxy)-2-nitro-4-(trifluoromethyl)benzene Preparation Products And Raw materials |
|