- Malaridine Impurity 19
-
- $0.00 / 10mg
-
2025-12-16
- CAS:6626-40-0
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 100000
|
| | 7,10-dichloro-2-methoxybenzo[b]-1,5-naphthyridine Basic information |
| Product Name: | 7,10-dichloro-2-methoxybenzo[b]-1,5-naphthyridine | | Synonyms: | 7,10-dichloro-2-methoxybenzo[b]-1,5-naphthyridine;PNB 100G;Benzo[b]-1,5-naphthyridine, 7,10-dichloro-2-methoxy-;Pyronaridine Impurity 1;Pyronaridine Impurity 10;2,7,10-trichlorobenzo[b][1,5]naphthyridine;Malaridine Impurity 19 | | CAS: | 6626-40-0 | | MF: | C13H8Cl2N2O | | MW: | 279.12 | | EINECS: | 229-588-9 | | Product Categories: | | | Mol File: | 6626-40-0.mol | ![7,10-dichloro-2-methoxybenzo[b]-1,5-naphthyridine Structure](CAS/GIF/6626-40-0.gif) |
| | 7,10-dichloro-2-methoxybenzo[b]-1,5-naphthyridine Chemical Properties |
| Melting point | 186-187 °C | | Boiling point | 434.0±40.0 °C(Predicted) | | density | 1.453±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Sparingly), DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | Solid | | pka | 0.49±0.40(Predicted) | | color | Pale Yellow | | InChI | InChI=1S/C13H8Cl2N2O/c1-18-11-5-4-9-13(17-11)12(15)8-3-2-7(14)6-10(8)16-9/h2-6H,1H3 | | InChIKey | KHPZCNJKNIHKPI-UHFFFAOYSA-N | | SMILES | N1=C2C(N=C(OC)C=C2)=C(Cl)C2=CC=C(Cl)C=C12 |
| | 7,10-dichloro-2-methoxybenzo[b]-1,5-naphthyridine Usage And Synthesis |
| Uses | 7,10-Dichloro-2-methoxybenzo[b][1,5]naphthyridine is used in the preparation of pyronaridine. |
| | 7,10-dichloro-2-methoxybenzo[b]-1,5-naphthyridine Preparation Products And Raw materials |
|