4,4'-oxybis(benzene-1,2-diamine) manufacturers
|
| | 4,4'-oxybis(benzene-1,2-diamine) Basic information |
| Product Name: | 4,4'-oxybis(benzene-1,2-diamine) | | Synonyms: | 4,4'-oxydi(1,2-benzenediamine);4,4'-oxybis(benzene-1,2-diamine);3,3',4,4'-Tetraaminodiphenyl ether;3,3,4,4-TETRAAMINODIPHENYL ETHER(TADE);4,4'-Oxybis(1,2-benzenediamine);4,4'-Oxybis(1,2-phenylenediamine);[2-amino-5-(3,4-diaminophenoxy)phenyl]amine;4-(3,4-diaminophenoxy)benzene-1,2-diamine | | CAS: | 2676-59-7 | | MF: | C12H14N4O | | MW: | 230.27 | | EINECS: | 220-226-5 | | Product Categories: | | | Mol File: | 2676-59-7.mol |  |
| | 4,4'-oxybis(benzene-1,2-diamine) Chemical Properties |
| Melting point | 147-150 °C | | Boiling point | 477.3±45.0 °C(Predicted) | | density | 1.361±0.06 g/cm3(Predicted) | | pka | 5.09±0.10(Predicted) | | InChI | InChI=1S/C12H14N4O/c13-9-3-1-7(5-11(9)15)17-8-2-4-10(14)12(16)6-8/h1-6H,13-16H2 | | InChIKey | RQBIGPMJQUKYAH-UHFFFAOYSA-N | | SMILES | O(C1C=C(N)C(N)=CC=1)C1C=CC(N)=C(N)C=1 |
| | 4,4'-oxybis(benzene-1,2-diamine) Usage And Synthesis |
| | 4,4'-oxybis(benzene-1,2-diamine) Preparation Products And Raw materials |
|