- Copper sulfate basic
-
- $0.00 / 1KG
-
2025-06-27
- CAS:1344-73-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- Copper sulfate basic
-
- $40.00 / 1kg
-
2025-06-20
- CAS:1344-73-6
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10 tons
- Copper sulfate basic
-
- $10.00 / 1kg
-
2023-07-31
- CAS:1344-73-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20tons
|
| | Copper sulfate basic Basic information |
| Product Name: | Copper sulfate basic | | Synonyms: | Sulfuric acid, copper salt, basic;COPPERSULPHATE,BASIC;Sulfuric acid, copper salt, basic、copper sulfate(basic);Basic copper sulfate;Copper sulfate basic;Copper sulfate basic(1344-73-6);Copper dihydroxosulphate;Fixed copper | | CAS: | 1344-73-6 | | MF: | CuH2O8S2 | | MW: | 257.69 | | EINECS: | 215-708-7 | | Product Categories: | UVCBs-inorganic | | Mol File: | 1344-73-6.mol |  |
| | Copper sulfate basic Chemical Properties |
| InChI | InChI=1S/2Cu.H2O4S.2H2O/c;;1-5(2,3)4;;/h;;(H2,1,2,3,4);2*1H2/q2*+2;;;/p-4 | | InChIKey | MTWQGJOZVKKEBG-UHFFFAOYSA-J | | SMILES | S(=O)([O-])([O-])=O.O[Cu+].O[Cu+] | | EPA Substance Registry System | Basic copper sulfate (1344-73-6) |
| | Copper sulfate basic Usage And Synthesis |
| Chemical Properties | Copper sulfate basic is a protective low-toxicity fungicide, commonly known as Bordeaux powder, Baoguolin, Green Depot, Bactericidal, Duobingning, with fine particle size, good dispersibility and rain resistance. It contains a large amount of calcium, boron, zinc, manganese and other trace elements, which can significantly improve the yield and fruit quality. Copper sulfate basic is the preferred fungicide for the production of green food and organic food. | | Uses | Used as sterilant, insecticide, etc. |
| | Copper sulfate basic Preparation Products And Raw materials |
|