- Isochroman-1-one
-
- $1.00
-
2026-07-01
- CAS:4702-34-5
- Purity: 97%
- Supply Ability: 500kg
- Isochroman-1-one
-
- $1.00
-
2025-12-12
- CAS:4702-34-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100000KG
|
| | 3,4-dihydro-1H-2-benzopyran-1-one Basic information |
| Product Name: | 3,4-dihydro-1H-2-benzopyran-1-one | | Synonyms: | 3,4-dihydro-1H-2-benzopyran-1-one;3,4-Dihydroisocoumarin;1H-2-Benzopyran-1-one,3,4-dihydro-(9CI);Einecs 225-179-4;3,4-dihydroisochroMen-1-one;1-oxo-isochroMan;1H-2-Benzopyran-1-one,3,4-dihydro-;isochroman-1-one: 3,4-dihydro-1H-2-benzopyran-1-one | | CAS: | 4702-34-5 | | MF: | C9H8O2 | | MW: | 148.16 | | EINECS: | 225-179-4 | | Product Categories: | PHENYL | | Mol File: | 4702-34-5.mol |  |
| | 3,4-dihydro-1H-2-benzopyran-1-one Chemical Properties |
| Melting point | 37-39 °C | | Boiling point | 160°C/11mmHg(lit.) | | density | 1.2030 | | refractive index | 1.5640 to 1.5680 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C9H8O2/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-4H,5-6H2 | | InChIKey | XVTAQSGZOGYIEY-UHFFFAOYSA-N | | SMILES | C1OC(=O)C2=CC=CC=C2C1 |
| | 3,4-dihydro-1H-2-benzopyran-1-one Usage And Synthesis |
| Definition | ChEBI: The simplest member of the class of dihydroisocoumarins that is the 3,4-dihydro derivative of isocoumarin. | | Synthesis Reference(s) | Journal of the American Chemical Society, 79, p. 3165, 1957 DOI: 10.1021/ja01569a047
Tetrahedron Letters, 37, p. 4179, 1996 DOI: 10.1016/0040-4039(96)00789-7 |
| | 3,4-dihydro-1H-2-benzopyran-1-one Preparation Products And Raw materials |
|