|
|
| | 2,3,3-trimethyl-3H-indole-5-carboxylic acid Basic information |
| Product Name: | 2,3,3-trimethyl-3H-indole-5-carboxylic acid | | Synonyms: | 2,3,3-trimethyl-3H-indole-5-carboxylic acid;Einecs 282-162-4;5-Carboxy-2,3,3-trimethyl-3H-indole, 2,3,3-Trimethylindolenine-5-carboxylic acid;2,3,3-Trimethyl-5-carboxyindolenine;2,3,3-trimethyl-5-carboxy-3H-indole;3H-Indole-5-carboxylic acid, 2,3,3-trimethyl-;2,3,3-Trimethyl-3H-indole-5-carbo;2,3,3-trimethylindole-5-carboxylic acid | | CAS: | 84100-84-5 | | MF: | C12H13NO2 | | MW: | 203.24 | | EINECS: | 282-162-4 | | Product Categories: | Labeling and Diagnostics Reagents;Chiral Reagents;Cyanine Dyes;Fluorescent Labels & Indicators;Piperazine derivates | | Mol File: | 84100-84-5.mol |  |
| | 2,3,3-trimethyl-3H-indole-5-carboxylic acid Chemical Properties |
| Melting point | 208-210℃ | | Boiling point | 350.2±42.0 °C(Predicted) | | density | 1.19 | | vapor pressure | 0Pa at 25℃ | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Ethanol (Slightly) | | form | Solid | | pka | 3.28±0.60(Predicted) | | color | Yellow to Dark Yellow | | Water Solubility | 442mg/L at 20℃ | | InChI | InChI=1S/C12H13NO2/c1-7-12(2,3)9-6-8(11(14)15)4-5-10(9)13-7/h4-6H,1-3H3,(H,14,15) | | InChIKey | QUDAPQXQGBIUAR-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(C(O)=O)C=C2)C(C)(C)C=1C | | LogP | 3.84 at 25℃ |
| | 2,3,3-trimethyl-3H-indole-5-carboxylic acid Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | Intermediate in the synthesis of cyanine dyes for fluorescence imaging of tumor hypoxia and as contrast agents for near-IR tumor imaging. | | Flammability and Explosibility | Not classified |
| | 2,3,3-trimethyl-3H-indole-5-carboxylic acid Preparation Products And Raw materials |
|