| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | propylene didecanoate Basic information |
| Product Name: | propylene didecanoate | | Synonyms: | Bisdecanoic acid 1-methyl-1,2-ethanediyl ester;Didecanoic acid 1,2-propanediyl ester;1,2-Propanediol didecanoate;1,2-Propylene glycol didecanoate;Decanoic acid, 1,1'-(1-methyl-1,2-ethanediyl) ester;Einecs 258-814-9;propylene didecanoate;PROPYLENE GLYCOL DICAPRATE | | CAS: | 53824-77-4 | | MF: | C23H44O4 | | MW: | 384.59 | | EINECS: | 258-814-9 | | Product Categories: | | | Mol File: | 53824-77-4.mol |  |
| | propylene didecanoate Chemical Properties |
| Boiling point | 453.3±18.0 °C(Predicted) | | density | 0.925±0.06 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 25℃ | | form | Liquid | | Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT | | InChI | InChI=1S/C23H44O4/c1-4-6-8-10-12-14-16-18-22(24)26-20-21(3)27-23(25)19-17-15-13-11-9-7-5-2/h21H,4-20H2,1-3H3 | | InChIKey | NFIHXTUNNGIYRF-UHFFFAOYSA-N | | SMILES | C(OC(=O)CCCCCCCCC)(C)COC(=O)CCCCCCCCC | | LogP | 8.68 | | EPA Substance Registry System | Propylene glycol didecanoate (53824-77-4) |
| | propylene didecanoate Usage And Synthesis |
| Uses | Propylene Glycol Dicaprate is commonly employed as a emulsifier for the food and cosmetic product. |
| | propylene didecanoate Preparation Products And Raw materials |
|