bis(5-oxo-L-prolinato-N1,O2)copper manufacturers
- COPPER PCA
-
- $2.00 / 100kg
-
2025-10-13
- CAS:15454-74-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | bis(5-oxo-L-prolinato-N1,O2)copper Basic information |
| Product Name: | bis(5-oxo-L-prolinato-N1,O2)copper | | Synonyms: | bis(5-oxo-L-prolinato-N1,O2)copper;Bis-(5-oxo-L-prolinato)-copper;Einecs 239-471-4;bis(5-oxo-L-prolinato-N1,O2)copper ISO 9001：2015 REACH;CU PCA;copper,5-oxopyrrolidine-2-carboxylate;Cooper PCA;Pyrrolidone Carboxylic Acid Copper | | CAS: | 15454-74-7 | | MF: | C10H10CuN2O6 | | MW: | 317.74 | | EINECS: | 239-471-4 | | Product Categories: | | | Mol File: | 15454-74-7.mol |  |
| | bis(5-oxo-L-prolinato-N1,O2)copper Chemical Properties |
| density | 0.952g/cm3 at 20℃ | | form | Solid | | InChI | InChI=1/2C5H7NO3.Cu/c2*7-4-2-1-3(6-4)5(8)9;/h2*3H,1-2H2,(H2,6,7,8,9);/q;;+4/p-4/t2*3-;/s3 | | InChIKey | IOKBBHFJOJTJRY-OFRCQBLNNA-J | | SMILES | O=C1CC[C@@]2([H])C(=O)[O-][Cu+2]3([O-]C(=O)[C@]4([H])CCC(=O)N34)N12 |&1:4,13,r| | | LogP | -0.72 |
| | bis(5-oxo-L-prolinato-N1,O2)copper Usage And Synthesis |
| Uses | Bis(5-oxo-L-prolinato-N1,O2)copper can be used as an intermediate in pharmaceutical synthesis. |
| | bis(5-oxo-L-prolinato-N1,O2)copper Preparation Products And Raw materials |
|