| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Products Intro: |
Product Name:1,1-diethoxy-3-phenylacetone
CAS:19256-31-6
Purity:98% Package:按需包装
|
| Company Name: |
Finetech Industry Limited
|
| Tel: |
027-87465837 19945049750 |
| Email: |
sales@finetechnology-ind.com |
| Products Intro: |
Product Name:1,1-diethoxy-3-phenylpropan-2-one
CAS:19256-31-6
Purity:98% Package:1g;10g;25g;500g;1kg
|
|
| | 1,1-diethoxy-3-phenylacetone Basic information |
| Product Name: | 1,1-diethoxy-3-phenylacetone | | Synonyms: | 1,1-diethoxy-3-phenylacetone;1,1-Diethoxy-3-phenylpropan-2-one;3-Phenylpyruvaldehyde diethyl acetal;2-Propanone, 1,1-diethoxy-3-phenyl-;Einecs 242-922-8;1,1-Diethoxy-3-Phenyl-2-Propanone | | CAS: | 19256-31-6 | | MF: | C13H18O3 | | MW: | 222.28 | | EINECS: | 242-922-8 | | Product Categories: | | | Mol File: | 19256-31-6.mol |  |
| | 1,1-diethoxy-3-phenylacetone Chemical Properties |
| storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C13H18O3/c1-3-15-13(16-4-2)12(14)10-11-8-6-5-7-9-11/h5-9,13H,3-4,10H2,1-2H3 | | InChIKey | LFYMGSKZVOVUKZ-UHFFFAOYSA-N | | SMILES | C(OCC)(OCC)C(=O)CC1=CC=CC=C1 | | EPA Substance Registry System | 2-Propanone, 1,1-diethoxy-3-phenyl- (19256-31-6) |
| | 1,1-diethoxy-3-phenylacetone Usage And Synthesis |
| | 1,1-diethoxy-3-phenylacetone Preparation Products And Raw materials |
|