|
|
| | N,N'-Dicinnamylidene-1,6-hexanediamine Basic information |
| Product Name: | N,N'-Dicinnamylidene-1,6-hexanediamine | | Synonyms: | N1,N6-Bis(3-phenylallylidene)hexane-1,6-diamine;N,N'-Bis(3-phenyl-2-propenylidene)-1,6-hexanediamine;1,6-Hexanediamine, N, N'-dicinnamylidene-;Aids124957;Aids-124957;Diak 3;Diak no. 3;Dicinnamylidene hexamethylenediamine | | CAS: | 140-73-8 | | MF: | C24H28N2 | | MW: | 344.49 | | EINECS: | 205-429-9 | | Product Categories: | | | Mol File: | 140-73-8.mol |  |
| | N,N'-Dicinnamylidene-1,6-hexanediamine Chemical Properties |
| Boiling point | 530.5±50.0 °C(Predicted) | | density | 0.92±0.1 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | 2-8°C | | pka | 7.05±0.50(Predicted) | | Water Solubility | 44mg/L at 25℃ | | InChI | InChI=1S/C24H28N2/c1(9-19-25-21-11-17-23-13-5-3-6-14-23)2-10-20-26-22-12-18-24-15-7-4-8-16-24/h3-8,11-18,21-22H,1-2,9-10,19-20H2 | | InChIKey | ATPFMBHTMKBVLS-UHFFFAOYSA-N | | SMILES | C(N=CC=CC1=CC=CC=C1)CCCCCN=CC=CC1=CC=CC=C1 | | LogP | 1.87 at 25℃ | | EPA Substance Registry System | 1,6-Hexanediamine, N,N'-bis(3-phenyl-2-propenylidene)- (140-73-8) |
| | N,N'-Dicinnamylidene-1,6-hexanediamine Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | N,N'-Dicinnamylidene-1,6-hexanediamine Preparation Products And Raw materials |
|