|
|
| | Diethyl 2-[4-(chlorobenzoyl)amino]Malonate Basic information | | Uses |
| Product Name: | Diethyl 2-[4-(chlorobenzoyl)amino]Malonate | | Synonyms: | diethyl (((4-chlorophenyl)carbonyl)amino)propanedioate;Diethyl 2-(4-chlorobenzaMido)Malonate;diethyl [(4-chlorobenzoyl)amino]propanedioate;diethyl 2-[(4-chlorobenzoyl)amino]propanedioate;Diethyl 2-[4-(chlorobenzoyl)amino]Malonate;DIETHYL 4-CHLOROBENZAMIDOMALONATE[REBAMIPIDE INTERMEDIATE];[(4-Chlorobenzoyl)-amino]-propanedioic acid diethyl ester;Propanedioic acid, 2-[(4-chlorobenzoyl)amino]-, 1,3-diethyl ester | | CAS: | 81918-01-6 | | MF: | C14H16ClNO5 | | MW: | 313.73 | | EINECS: | | | Product Categories: | (intermediate of rebamipide) | | Mol File: | 81918-01-6.mol | ![Diethyl 2-[4-(chlorobenzoyl)amino]Malonate Structure](CAS/GIF/81918-01-6.gif) |
| | Diethyl 2-[4-(chlorobenzoyl)amino]Malonate Chemical Properties |
| Boiling point | 458.6±45.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.56±0.46(Predicted) | | InChI | InChI=1S/C14H16ClNO5/c1-3-20-13(18)11(14(19)21-4-2)16-12(17)9-5-7-10(15)8-6-9/h5-8,11H,3-4H2,1-2H3,(H,16,17) | | InChIKey | KTKBMOLVXVIHQA-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(NC(=O)C1=CC=C(Cl)C=C1)C(OCC)=O |
| | Diethyl 2-[4-(chlorobenzoyl)amino]Malonate Usage And Synthesis |
| Uses | Diethyl 2-(4-chlorobenzamido)malonate is a reagent used in the synthesis of indole-based PPARγ ligands | | Uses | Diethyl 2-(4-chlorobenzamido)malonate is a reagent used in the synthesis of indole-based PPARγ ligands |
| | Diethyl 2-[4-(chlorobenzoyl)amino]Malonate Preparation Products And Raw materials |
|