| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3,5-DIMETHOXY-4-HYDROXYCINNAMIC ACID Basic information |
| Product Name: | 3,5-DIMETHOXY-4-HYDROXYCINNAMIC ACID | | Synonyms: | trans-4-Hydroxy-3,5-dimethoxy-cinnamic acid;trans-Sinapinic acid;2-Propenoic acid, 3-(4-hydroxy-3,5-dimethoxyphenyl)-, (2E)-;trans-Sinapic acid-RM;trans-Sinapic acid;trans-Sinapic acid | | CAS: | 7362-37-0 | | MF: | C11H12O5 | | MW: | 224.21 | | EINECS: | 208-487-3 | | Product Categories: | | | Mol File: | 7362-37-0.mol |  |
| | 3,5-DIMETHOXY-4-HYDROXYCINNAMIC ACID Chemical Properties |
| Melting point | 195-205°C (dec.) | | solubility | DMSO (Slightly), Ethanol (Slightly, Heated), Methanol (Slightly) | | Stability: | Light Sensitive | | Major Application | food and beverages | | InChI | 1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3+ | | InChIKey | PCMORTLOPMLEFB-ONEGZZNKSA-N | | SMILES | COc1cc(\C=C\C(O)=O)cc(OC)c1O | | LogP | 1.286 (est) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,5-DIMETHOXY-4-HYDROXYCINNAMIC ACID Usage And Synthesis |
| Uses | trans-Sinapic acid may be used as an analytical reference standard for the quantification of the analyte in seed samples and vegetables using different chromatography techniques. | | Definition | ChEBI: A sinapic acid in which the double bond has trans-configuration. |
| | 3,5-DIMETHOXY-4-HYDROXYCINNAMIC ACID Preparation Products And Raw materials |
|