|
|
| | 4-Methylphenyl 1-thio-b-D-glucopyranoside Basic information |
| Product Name: | 4-Methylphenyl 1-thio-b-D-glucopyranoside | | Synonyms: | 4-Methylphenyl 1-thio-beta-D-glucopyranoside min. 99%;Tolyl 1-thio-beta-D-glucopyranoside, Thiocresyl beta-D-glucopyranoside;4-Methylphenyl 1-thio-b-D-glucopyranoside;p-Tolyl 1-thio-β-D-glucopyranoside;p-Tolyl β-D-thioglucopyranoside;B-D-Glucopyranoside,4-methylphenyl1-thio-;4-Methylphenyl β-D-thioglucopyranoside;4-Methylphenyl b-D-thioglucopyranoside | | CAS: | 1152-39-2 | | MF: | C13H18O5S | | MW: | 286.34 | | EINECS: | | | Product Categories: | | | Mol File: | 1152-39-2.mol |  |
| | 4-Methylphenyl 1-thio-b-D-glucopyranoside Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | InChI | 1S/C13H18O5S/c1-7-2-4-8(5-3-7)19-13-12(17)11(16)10(15)9(6-14)18-13/h2-5,9-17H,6H2,1H3/t9-,10-,11+,12-,13+/m1/s1 | | InChIKey | IQCLIQLFPVKINX-LBELIVKGSA-N | | SMILES | Cc1ccc(S[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| WGK Germany | 3 | | HS Code | 29329990 | | Storage Class | 13 - Non Combustible Solids |
| | 4-Methylphenyl 1-thio-b-D-glucopyranoside Usage And Synthesis |
| Uses | 4-Methylphenyl 1-thio-β-D-glucopyranoside is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1]. | | References | [1] Varki A, et al editors. Essentials of Glycobiology [Internet]. 4th ed. Cold Spring Harbor (NY): Cold Spring Harbor Laboratory Press; 2022. PMID:35536922 |
| | 4-Methylphenyl 1-thio-b-D-glucopyranoside Preparation Products And Raw materials |
|