| Company Name: |
Changzhou Qiyu Biotechnology Co., Ltd. Gold
|
| Tel: |
13961298435 |
| Email: |
zzyqqq@163.com |
| Products Intro: |
Product Name:tert-butyl 4-methylphenyl ether CAS:15359-98-5 Purity:98% Package:100g;500g;1kg
|
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Tel: |
0573-85285100 18627885956 |
| Email: |
isenchem@163.com |
| Products Intro: |
CAS:15359-98-5 Purity:98% (HPLC OR GC) Package:25g,100g,500g;1kg
|
| Company Name: |
Shanghai Sphchem Co., Ltd.
|
| Tel: |
021-56491756 13512199871 |
| Email: |
2819742715@qq.com |
| Products Intro: |
Product Name:tert-butyl 4-methylphenyl ether CAS:15359-98-5 Package:1g/1
|
|
| | tert-butyl 4-methylphenyl ether Basic information |
| Product Name: | tert-butyl 4-methylphenyl ether | | Synonyms: | tert-butyl 4-methylphenyl ether;4-tert-Butoxytoluene;tert-Butyl p-tolyl ether;tert-Butyl(p-tolyl) ether;Benzene, 1-(1,1-dimethylethoxy)-4-methyl-;4-tert-butyloxytoluene;4-Methylphenyl tert-butyl ether;p-tert-Butoxytoluene | | CAS: | 15359-98-5 | | MF: | C11H16O | | MW: | 164.24 | | EINECS: | | | Product Categories: | | | Mol File: | 15359-98-5.mol |  |
| | tert-butyl 4-methylphenyl ether Chemical Properties |
| Boiling point | 220℃ | | density | 0.916 | | refractive index | 1.4882 | | Fp | 90℃ | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C11H16O/c1-9-5-7-10(8-6-9)12-11(2,3)4/h5-8H,1-4H3 | | InChIKey | FETIWDPIODONQB-UHFFFAOYSA-N | | SMILES | C1(OC(C)(C)C)=CC=C(C)C=C1 |
| | tert-butyl 4-methylphenyl ether Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 81, p. 4230, 1959 DOI: 10.1021/ja01525a028 |
| | tert-butyl 4-methylphenyl ether Preparation Products And Raw materials |
|