|
|
| | DI-U-CHLOROBIS[5-CHLORO-2-((4-CHLOROPHE& Basic information |
| Product Name: | DI-U-CHLOROBIS[5-CHLORO-2-((4-CHLOROPHE& | | Synonyms: | Di-mu-chlorobis[5-chloro-2-[(4-chlorophenyl)(hydroxyimino)methyl]phenyl]palladium(II) Dimer;Di-μ-chlorobis[5-chloro-2-[(4-chlorophenyl)(hydroxyimino-κN)methyl]phenyl-κC]palladium dimer 97%;Di-μ-chlorobis[5-chloro-2-[(4-chlorophenyl)(hydroxyiMino-κN)Methyl]phenyl-κC]palladiuM diMer,97%;Najera Catalyst I;Di-μ-chlorobis[5-chloro-2-[(4-chlorophenyl)(hydroxyiMino)Methyl]phenyl]palladiuM(II) DiMer;Palladium, di-m-chlorobis[5-chloro-2-[(4-chlorophenyl)(hydroxyimino-kN)methyl]phenyl-kC]di-;DI-U-CHLOROBIS[5-CHLORO-2-((4-CHLOROPHE&;Di-μ-chlorobis[5-chloro-2-[(4-chlorophenyl)(hydroxyimino-KN)methyl]phenyl-KC]palladium dimer | | CAS: | 287410-78-0 | | MF: | C26H16Cl6N2O2Pd2 | | MW: | 813.97 | | EINECS: | | | Product Categories: | Pd | | Mol File: | 287410-78-0.mol |  |
| | DI-U-CHLOROBIS[5-CHLORO-2-((4-CHLOROPHE& Chemical Properties |
| Melting point | 208-210 °C | | form | powder to crystal | | color | White to Amber | | InChI | 1S/2C13H8Cl2NO.2ClH.2Pd/c2*14-11-5-1-9(2-6-11)13(16-17)10-3-7-12(15)8-4-10;;;;/h2*1-3,5-8,17H;2*1H;;/q;;;;2*+1/p-2/b2*16-13+;;;; | | InChIKey | GIMFEGPTUHULMU-VAABLSLRSA-L | | SMILES | O\N=C(/c1ccc(Cl)cc1)c2ccc(Cl)cc2[Pd]Cl.O\N=C(/c3ccc(Cl)cc3)c4ccc(Cl)cc4[Pd]Cl |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2931.90.6000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | DI-U-CHLOROBIS[5-CHLORO-2-((4-CHLOROPHE& Usage And Synthesis |
| Uses | Highly effective catalyst for multiple aryl vinylation via Heck coupling. Palladacycle catalyst employed in a variety of carbon-carbon bond forming reactions. | | reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
| | DI-U-CHLOROBIS[5-CHLORO-2-((4-CHLOROPHE& Preparation Products And Raw materials |
|