|
|
| | 2,6-DIFLUORO-4-FORMYLPHENYLBORONIC ACID& Basic information |
| Product Name: | 2,6-DIFLUORO-4-FORMYLPHENYLBORONIC ACID& | | Synonyms: | 2,6-Difluoro-4-formylphenylboronic acid pinacol ester 97%;Benzaldehyde, 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;3,5-difluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde | | CAS: | 870717-92-3 | | MF: | C13H15BF2O3 | | MW: | 268.06 | | EINECS: | | | Product Categories: | | | Mol File: | 870717-92-3.mol |  |
| | 2,6-DIFLUORO-4-FORMYLPHENYLBORONIC ACID& Chemical Properties |
| Melting point | 135-139 °C | | Boiling point | 334.8±42.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C13H15BF2O3/c1-12(2)13(3,4)19-14(18-12)11-9(15)5-8(7-17)6-10(11)16/h5-7H,1-4H3 | | InChIKey | KWYZDHWDFMOVOR-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2c(F)cc(C=O)cc2F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,6-DIFLUORO-4-FORMYLPHENYLBORONIC ACID& Usage And Synthesis |
| | 2,6-DIFLUORO-4-FORMYLPHENYLBORONIC ACID& Preparation Products And Raw materials |
|