| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | Benzeneethanamine, α-(4-fluorophenyl)- Basic information |
| | Benzeneethanamine, α-(4-fluorophenyl)- Chemical Properties |
| Boiling point | 301.1±27.0 °C(Predicted) | | density | 1.123±0.06 g/cm3(Predicted) | | form | solid | | pka | 8.72±0.10(Predicted) | | InChI | 1S/C14H14FN/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9,14H,10,16H2 | | InChIKey | LYNHBBICXLUZHS-UHFFFAOYSA-N | | SMILES | FC1=CC=C(C(CC2=CC=CC=C2)N)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Sens. 1 |
| | Benzeneethanamine, α-(4-fluorophenyl)- Usage And Synthesis |
| | Benzeneethanamine, α-(4-fluorophenyl)- Preparation Products And Raw materials |
|