- Isochlorogenic acid B
-
- $0.00 / 20mg
-
2023-02-24
- CAS:14534-61-3
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Isochlorogenic Acid B
-
- $1.00 / 1KG
-
2019-07-14
- CAS:14534-61-3
- Min. Order: 1KG
- Purity: 90%-99.9%
- Supply Ability: 500kg
|
| | Isochlorogenic Acid B Basic information |
| Product Name: | Isochlorogenic Acid B | | Synonyms: | Isochlorogenic acid B, froM Lonicera japonica;3,4-Dicaffeoylquinic acid;Isochlorogenic acid B;Isochlorogenic acid B，3,4-Dicaffeoylquinic acid;(1S)-1α,5α-Dihydroxy-3β,4α-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1β-cyclohexanecarboxylic acid;(1S)-4β,5α-Bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1β,3β-dihydroxycyclohexanecarboxylic acid;1β,3β-Dihydroxy-4β,5α-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1α-cyclohexanecarboxylic acid;ISOCHLOROGENIC ACID B(RG) | | CAS: | 14534-61-3 | | MF: | C25H24O12 | | MW: | 516.45 | | EINECS: | | | Product Categories: | The group of Chlorogenic acid;chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 14534-61-3.mol |  |
| | Isochlorogenic Acid B Chemical Properties |
| Melting point | >117°C (sub.) | | Boiling point | 810.8±65.0 °C(Predicted) | | density | 1?+-.0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Methanol (Slightly) | | form | Solid | | pka | 3.70±0.50(Predicted) | | color | Off-White to Light Yellow | | InChIKey | UFCLZKMFXSILNL-BBLPPJRLSA-N | | SMILES | [C@]1(O)(C(O)=O)C[C@@H](O)[C@@H](OC(=O)C=CC2=CC=C(O)C(O)=C2)[C@H](OC(=O)C=CC2=CC=C(O)C(O)=C2)C1 | | LogP | 0.890 (est) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29189900 |
| | Isochlorogenic Acid B Usage And Synthesis |
| Chemical Properties | Colorless crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from honeysuckle, honeysuckle, and eucommia. | | Uses | Isochlorgenic Acid is shown to provide antioxidant and DNA-protective activities. | | Definition | ChEBI: Isochlorogenic acid b is a quinic acid. | | Biological Activity | 3,4-Di-O-caffeoylquinic acid, along with 3,5-dicaffeoylquinic acid and luteolin-7-O-glucoside, is a component of the medicinal herb Youngia japonica. It has known antiviral activity and along with 3,5,-dicaffeoylquinic acid, shows activity against respiratory syncyntial virus (RSV). 3,4-COQ elicits antioxidant effects which mediate its neuroprotective effects against in vitro retinal damage. It also exerts cytoprotective effects against oxidative damage in bone marrow-derived mesenchymal stem cells (bmMSCs). | | target | PDE-5 |
| | Isochlorogenic Acid B Preparation Products And Raw materials |
|