|
|
| | Cyclopropyl 2-fluorobenzyl ketone Chemical Properties |
| Boiling point | 61°C/0.2mmHg(lit.) | | density | 1.192±0.06 g/cm3(Predicted) | | refractive index | 1.5150-1.5190 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless to Light Yellow | | InChI | InChI=1S/C11H11FO/c12-10-4-2-1-3-9(10)7-11(13)8-5-6-8/h1-4,8H,5-7H2 | | InChIKey | DWBGTJUQWKWYGB-UHFFFAOYSA-N | | SMILES | C(=O)(C1CC1)CC1=CC=CC=C1F | | CAS DataBase Reference | 150322-73-9(CAS DataBase Reference) |
| | Cyclopropyl 2-fluorobenzyl ketone Usage And Synthesis |
| Description | Cyclopropyl 2-fluorobenzyl ketone is a kind of ketone derivative. It is a kind of pharmacological intermediate. It is a pharmacological intermediate during the preparation of Prasugrel which is a kind of platelet inhibitors used for preventing the formation of blood clots.
| | References | Al Omari, Mahmoud MH, et al. "Chapter Four-Prasugrel Hydrochloride."Profiles of Drug Substances, Excipients and Related Methodology 40 (2015): 195-320.
| | Chemical Properties | Pale Yellow Oil | | Uses | Atomoxetine intermediate | | Uses | Prasugrel intermediate. |
| | Cyclopropyl 2-fluorobenzyl ketone Preparation Products And Raw materials |
|