| Company Name: |
Daicel Chiral Technologies (China)CO.,LTD
|
| Tel: |
021-50460086-9 15921403865 |
| Email: |
han_yajun@dctc.daicel.com |
| Products Intro: |
Product Name:Vitamin K3-2,3-epoxide Impurity CAS:15448-59-6 Purity:95%HPLC Package:10MG;25MG;50MG;100MG Remarks:DCTI-C-1382
|
| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Vitamin K1 Impurity 95 CAS:15448-59-6 Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Vitamin K1 Impurity 95 CAS:15448-59-6 Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Shanghai HuanChuan Industry Co.,Ltd.
|
| Tel: |
021-61478794 |
| Email: |
sales@hcshhai.com |
| Products Intro: |
Product Name:2-Methyl-2,3-epoxy-2,3-dihydronaphthalene-1,4-dione CAS:15448-59-6 Purity:97% Package:100g 1kg
|
|
| | Naphth[2,3-b]oxirene-2,7-dione, 1a,7a-dihydro-1a-methyl- (9CI) Basic information |
| Product Name: | Naphth[2,3-b]oxirene-2,7-dione, 1a,7a-dihydro-1a-methyl- (9CI) | | Synonyms: | NSC 65669;Vitamin K3 2,3-epoxide;1A,7A-DIHYDRO-1A-METHYLNAPHTH[2,3-B]OXIRENE-2,7-DIONE(WXG00549);menadione epoxide;1a,7a-Dihydro-1a-methylnaphth[2,3-b]oxirene-2,7-dione;1a-Methyl-1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione;2,3-Epoxy-2,3-dihydro-2-methyl-1,4-naphthoquinone;2-Methyl-2,3-epoxy-2,3-dihydronaphthalene-1,4-dione | | CAS: | 15448-59-6 | | MF: | C11H8O3 | | MW: | 188.18 | | EINECS: | | | Product Categories: | EPOXYDE | | Mol File: | 15448-59-6.mol | ![Naphth[2,3-b]oxirene-2,7-dione, 1a,7a-dihydro-1a-methyl- (9CI) Structure](CAS/GIF/15448-59-6.gif) |
| | Naphth[2,3-b]oxirene-2,7-dione, 1a,7a-dihydro-1a-methyl- (9CI) Chemical Properties |
| Melting point | 100-101 °C | | Boiling point | 357.4±42.0 °C(Predicted) | | density | 1.406±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder | | color | white | | BRN | 144630 | | Major Application | cell analysis | | InChI | 1S/C11H8O3/c1-11-9(13)7-5-3-2-4-6(7)8(12)10(11)14-11/h2-5,10H,1H3 | | InChIKey | NNUKDUBCRRYXDC-UHFFFAOYSA-N | | SMILES | O=C1C2(C)C(O2)C(C3=CC=CC=C31)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Naphth[2,3-b]oxirene-2,7-dione, 1a,7a-dihydro-1a-methyl- (9CI) Usage And Synthesis |
| Uses | Menadione 2,3-Epoxide is a Vitamin K derivative found to induce selective tumor cytotoxicty in neublastoma as well as induce apotosis through activiation of ROS-dependent ERK and JNK protein phosphorylation. | | Biological Activity | Metabolite of vitamin K metabolism. |
| | Naphth[2,3-b]oxirene-2,7-dione, 1a,7a-dihydro-1a-methyl- (9CI) Preparation Products And Raw materials |
|