|
|
| | Carbamic acid, (3-hydroxycyclopentyl)-, 1,1-dimethylethyl ester, (1S-trans)- Basic information |
| Product Name: | Carbamic acid, (3-hydroxycyclopentyl)-, 1,1-dimethylethyl ester, (1S-trans)- | | Synonyms: | (1S,3S)-tert-butyl(3-hydroxycyclopentyl)catbaMte;tert-Butyl ((1S,3S);Carbamic acid, (3-hydroxycyclopentyl)-, 1,1-dimethylethyl ester, (1S-trans)-;Carbamic acid, [(1S,3S)-3-hydroxycyclopentyl]-, 1,1-dimethylethyl ester, rel-;tert-butyl (1S,3S)-3-hydroxycyclopentylcarbamate;tert-butyl N-[(1S,3S)-3-hydroxycyclopentyl]carbamate;(3-Hydroxycyclopentyl)carbamic acid 1,1-dimethylethyl ester;N-[(1S,3S)-3-Hydroxycyclopentyl]carbamic acid 1,1-dimethylethyl ester | | CAS: | 154737-89-0 | | MF: | C10H19NO3 | | MW: | 201.26 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 154737-89-0.mol |  |
| | Carbamic acid, (3-hydroxycyclopentyl)-, 1,1-dimethylethyl ester, (1S-trans)- Chemical Properties |
| Boiling point | 320.8±31.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.27±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-7-4-5-8(12)6-7/h7-8,12H,4-6H2,1-3H3,(H,11,13)/t7-,8-/m0/s1 | | InChIKey | SBUKINULYZANSP-YUMQZZPRSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H]1CC[C@H](O)C1 |
| | Carbamic acid, (3-hydroxycyclopentyl)-, 1,1-dimethylethyl ester, (1S-trans)- Usage And Synthesis |
| | Carbamic acid, (3-hydroxycyclopentyl)-, 1,1-dimethylethyl ester, (1S-trans)- Preparation Products And Raw materials |
|