| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | Methoxy-PEG-propionicacid-N-succinimidylester Basic information |
| | Methoxy-PEG-propionicacid-N-succinimidylester Chemical Properties |
| Melting point | 47.19 °C | | storage temp. | -20°C | | solubility | Soluble in DMSO, DCM, DMF | | form | solid | | color | white to off-white | | α-end | methoxy | | Ω-end | NHS ester | | InChI | InChI=1S/C10H15NO6/c1-15-6-7-16-5-4-10(14)17-11-8(12)2-3-9(11)13/h2-7H2,1H3 | | InChIKey | IMSXKORGOVQCNT-UHFFFAOYSA-N | | SMILES | O(N1C(CCC1=O)=O)C(=O)CCO{-}CC{+n}OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Methoxy-PEG-propionicacid-N-succinimidylester Usage And Synthesis |
| Description | m-PEG12-NHS ester is a PEG linker containing an NHS ester. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The hydrophilic PEG spacer increases solubility in aqueous media. | | Uses | m-PEGn-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | reaction suitability | reagent type: chemical modification reagent
reactivity: amine reactive | | IC 50 | PEGs | | References | [1] Nalawansha DA, et al. PROTACs: An Emerging Therapeutic Modality in Precision Medicine. Cell Chem Biol. 2020;27(8):998-985. DOI:10.7554/eLife.57277 |
| | Methoxy-PEG-propionicacid-N-succinimidylester Preparation Products And Raw materials |
|