|
|
| | 4(1H)-Pyrimidinone, 5-amino- (9CI) Basic information |
| | 4(1H)-Pyrimidinone, 5-amino- (9CI) Chemical Properties |
| Melting point | 206-208 °C | | density | 1.55±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 8.89±0.40(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C4H5N3O/c5-3-1-6-2-7-4(3)8/h1-2H,5H2,(H,6,7,8) | | InChIKey | XWLBYEBHQNSCKA-UHFFFAOYSA-N | | SMILES | C1=NC=C(N)C(=O)N1 |
| | 4(1H)-Pyrimidinone, 5-amino- (9CI) Usage And Synthesis |
| Uses | 5-Aminopyrimidin-4-ol is used as a reactant in the synthesis of thrombin inhibitors using analogs of MD805 containing non-polar surrogates for arginine at P1 position. |
| | 4(1H)-Pyrimidinone, 5-amino- (9CI) Preparation Products And Raw materials |
|