|
|
| | 2-Phenyl-1,3,4-oxadiazole Basic information |
| Product Name: | 2-Phenyl-1,3,4-oxadiazole | | Synonyms: | 2-Phenyloxadiazole;5-Phenyl-1,3,4-Oxadiazole;NSC 94884;2-Phenyl-1,3,4-oxadiazole;1,3,4-Oxadiazole, 2-phenyl- | | CAS: | 825-56-9 | | MF: | C8H6N2O | | MW: | 146.15 | | EINECS: | | | Product Categories: | | | Mol File: | 825-56-9.mol |  |
| | 2-Phenyl-1,3,4-oxadiazole Chemical Properties |
| Melting point | 34 °C | | Boiling point | 254℃ | | density | 1.179 | | Fp | 111℃ | | storage temp. | 2-8°C | | pka | -4.52±0.32(Predicted) | | Appearance | Colorless to off-white <34°C Solid,>34°C Liquid | | InChI | InChI=1S/C8H6N2O/c1-2-4-7(5-3-1)8-10-9-6-11-8/h1-6H | | InChIKey | ZEOMRHKTIYBETG-UHFFFAOYSA-N | | SMILES | O1C=NN=C1C1=CC=CC=C1 |
| | 2-Phenyl-1,3,4-oxadiazole Usage And Synthesis |
| | 2-Phenyl-1,3,4-oxadiazole Preparation Products And Raw materials |
|