Tetrabutylammonium periodate manufacturers
|
| | Tetrabutylammonium periodate Basic information |
| | Tetrabutylammonium periodate Chemical Properties |
| Melting point | 175 °C (dec.) (lit.) | | density | 1.2302 (estimate) | | storage temp. | Storage temp. 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | solid | | Appearance | white crystalline solid | | BRN | 4621593 | | InChI | 1S/C16H36N.HIO4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)5/h5-16H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 | | InChIKey | PYVXLMQALOZKES-UHFFFAOYSA-M | | SMILES | [O-]I(=O)(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
| Hazard Codes | O,Xi,Xn | | Risk Statements | 8-36/37/38-20/22 | | Safety Statements | 17-26-36-37/39 | | RIDADR | UN 1479 5.1/PG 2 | | WGK Germany | 3 | | F | 8 | | HazardClass | 4.1 | | PackingGroup | II | | HS Code | 29239000 | | Storage Class | 5.1B - Oxidizing hazardous materials | | Hazard Classifications | Eye Irrit. 2
Ox. Sol. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetrabutylammonium periodate Usage And Synthesis |
| Description | Tetrabutylammonium periodate is useful reagent in oxidation of sulfides, phenacyl bromides, benzyl halides, phosphites; oxidative decarboxylation; co-oxidant in metal-catalyzed oxidation. | | Chemical Properties | yellow crystalline powder | | Uses | Tetrabutylammonium (meta)periodate (DCM) can be oxidated for the synthesis of aryl nitroso derivatives. It can also be used in the formation of an ionic liquid for the synthesis of aromatic carboxylic acids. | | reaction suitability | reagent type: oxidant | | storage | Tetrabutylammonium periodate is best stored in the dark because it readily turns yellow on exposure to light. There is no loss of oxidizing power on prolonged storage. |
| | Tetrabutylammonium periodate Preparation Products And Raw materials |
|