Methyl N-Boc-L-proline-3-ene manufacturers
|
| | Methyl N-Boc-L-proline-3-ene Basic information |
| Product Name: | Methyl N-Boc-L-proline-3-ene | | Synonyms: | METHYL N-BOC-L-PROLINE-3-ENE;(S)-2,5-Dihydro-pyrrole-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester;(S)-Boc-3,4-dehydro-pyrrolidine methyl ester;Boc-3,4-dehydro-L-proline methyl ester99%;Boc-3,4-dehydro-L-Pro-OMe;1-(1,1-dimethylethyl) 2-methyl ester 2,5-dihydro-1H-Pyrrole-1,2-dicarboxylic acid, (2S)-;1-tert-butyl 2-Methyl 2,5-dihydro-1H-pyrrole-1,2-dicarboxylate;(S)-1-tert-butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate | | CAS: | 74844-93-2 | | MF: | C11H17NO4 | | MW: | 227.26 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 74844-93-2.mol |  |
| | Methyl N-Boc-L-proline-3-ene Chemical Properties |
| Boiling point | 287.3±40.0 °C(Predicted) | | density | 1.148±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | form | Liquid | | pka | -3.53±0.40(Predicted) | | color | Slight yellow | | InChI | InChI=1S/C11H17NO4/c1-11(2,3)16-10(14)12-7-5-6-8(12)9(13)15-4/h5-6,8H,7H2,1-4H3/t8-/m0/s1 | | InChIKey | YDQDZLXTPXNOKO-QMMMGPOBSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC=C[C@H]1C(OC)=O |
| | Methyl N-Boc-L-proline-3-ene Usage And Synthesis |
| Chemical Properties | Off-white to white powder. | | Uses | Methyl N-Boc-L-proline-3-ene can be used as an organic synthesis reagent or intermediate component in the preparation of skeletons for other organic compounds. |
| | Methyl N-Boc-L-proline-3-ene Preparation Products And Raw materials |
|