| Company Name: |
Eastbang Pharmaceuticals Technology Co., Ltd.
|
| Tel: |
+86 (20) 28996708,29078958,28139708,29076128,28133708,28139728,28139738,28133718,021-31663278,021-31663578,021-60538387 |
| Email: |
|
| Products Intro: |
Product Name:SuMatriptan CAS:103628-46-4 Purity:99% Package:100g;1kg;25kg;100kg
|
|
| | SuMatriptan Basic information |
| Product Name: | SuMatriptan | | Synonyms: | | | CAS: | | | MF: | C14H21N3O2S | | MW: | 295.40044 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | SuMatriptan Chemical Properties |
| InChI | InChI=1S/C14H21N3O2S/c1-15-20(18,19)10-11-4-5-14-13(8-11)12(9-16-14)6-7-17(2)3/h4-5,8-9,15-16H,6-7,10H2,1-3H3 | | InChIKey | KQKPFRSPSRPDEB-UHFFFAOYSA-N | | SMILES | O=S(=O)(NC)CC1=CC2C(CCN(C)C)=CNC=2C=C1 |
| | SuMatriptan Usage And Synthesis |
| | SuMatriptan Preparation Products And Raw materials |
|