- Cucurbitacin B
-
- $0.00 / 1Kg/Bag
-
2026-03-31
- CAS:6199-67-3
- Min. Order: 1KG
- Purity: Cucurbitacin B≥60%
- Supply Ability: 500kg
- CUCURBITACIN B
-
- $998.00 / 1g
-
2026-03-19
- CAS:6199-67-3
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1-20kg
- Cucurbitacin B
-
- $44.00 / 1mg
-
2026-03-13
- CAS:6199-67-3
- Min. Order:
- Purity: 99.93%
- Supply Ability: 10g
|
| | CUCURBITACIN B Basic information |
| Product Name: | CUCURBITACIN B | | Synonyms: | (2beta,9beta,10alpha,16alpha,23e)-thyl;19-nor-9-beta,10-alpha-lanosta-5,23-diene-3,11,22-trione,2-beta,16-alpha,20,25;19-nor-9beta,10alpha-lanosta-5,23-diene-3,11,22-trione,2beta,16alpha,20,25-tet;19-norlanosta-5,23-diene-3,11,22-trione,25-(acetyloxy)-2,16,20-trihydroxy-9-me;25-(acetyloxy)-2,16,20-trihydroxy-9-methyl-19-norlanosta-5,23-diene-3,11,22-tr;Cucurbitacin B hydrate;Cucurbitacin B, 98%, from Cucumis melo L.;cucurbitacineb | | CAS: | 6199-67-3 | | MF: | C32H46O8 | | MW: | 558.7 | | EINECS: | | | Product Categories: | Tri-Terpenoids;chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 6199-67-3.mol |  |
| | CUCURBITACIN B Chemical Properties |
| Melting point | 184-186° | | alpha | D25 +88° (c = 1.55 in ethanol) | | Boiling point | 546.74°C (rough estimate) | | density | 1.0953 (rough estimate) | | refractive index | 1.4900 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | solubility | DMSO: soluble10mg/mL, clear | | pka | 12.60±0.29(Predicted) | | form | powder | | color | white to beige | | λmax | 290nm(EtOH)(lit.) | | Merck | 14,2614 | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChIKey | IXQKXEUSCPEQRD-ALLWXVAWSA-N | | SMILES | CC1(C)C([C@@H](O)C[C@]2([H])C1=CC[C@]([C@@](C[C@@H](O)[C@]3([H])[C@@](C)(O)C(/C=C/C(C)(C)OC(C)=O)=O)(C)[C@]3(C)C4)([H])[C@@]2(C)C4=O)=O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45-24/25 | | RIDADR | UN 2811 6.1 / PGI | | WGK Germany | 3 | | RTECS | RC6190000 | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 29153900 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral | | Hazardous Substances Data | 6199-67-3(Hazardous Substances Data) | | Toxicity | LD10 orally in mice: 5 mg/kg (LeMen) |
| | CUCURBITACIN B Usage And Synthesis |
| Description | Cucurbitacin B is a tetracyclic triterpenoid that has been shown to have a strong antitumor activity. | | Chemical Properties | White solid | | Uses | Cucurbitacin B hydrate has been used:
- as a signal transducer and activator of transcription 3 (stat3) inhibitor to determine its effect on the expression of human lysosomal acid lipase (hLAL) in myeloid-derived suppressor cells (MDSCs).
- as an ecdysone receptor (EcR) antagonist injection to lower the levels of 20-hydoxyecdysone (20E) signaling in butterflies.
- to determine its effect on the cell viability of pancreatic cancer cell lines.
| | Definition | ChEBI: A cucurbitacin in which a lanostane skeleton is multi-substituted with hydroxy, methyl and oxo substituents, with unsaturation at positions 5 and 23; a hydroxy function at C-25 is acetylated. | | Biochem/physiol Actions | Cucurbitacin B is a triterpenoid constituent of Cucurbitaceae plant species. Cucurbitacin B inhibits proliferation in a wide variety of tumor cell lines (IC50 15-30 nM) by inducing apoptosis and inducing cell cycle arrest at G2/M phase. Although the mechanism of action is unclear, Cucurbitacin B inhibits STAT 3 phosphorylation and expression levels and has been shown to block JAK2 activity. Curcubitacin B also inhibits the transcriptional activity of HIF1a and Nf-KB. Curcubitacin B is structurally similar to the JAK inhibitor Curcubitacin I. |
| | CUCURBITACIN B Preparation Products And Raw materials |
|