3,7,11,15-TETRAMETHYL-2-HEXADECEN-1-OL manufacturers
- (Z,E)-phytol
-
- $1.00 / 1KG
-
2022-02-25
- CAS:7541-49-3
- Min. Order: 100g/Bag
- Purity: 98%
- Supply Ability: 3tons
|
| | 3,7,11,15-TETRAMETHYL-2-HEXADECEN-1-OL Basic information |
| Product Name: | 3,7,11,15-TETRAMETHYL-2-HEXADECEN-1-OL | | Synonyms: | 3,7,11,15-TETRAMETHYL-2-HEXADECEN-1-OL;PHYTOL 97+%;PHYTOL, 97%, MIXTURE OF ISOMERS;Phytolnaturalisomer;2-Hexadecen-1-ol, 3,7,11,15-tetramethyl-;Phytol ,90% [mixture of isomers];Phytol 99+% (Natural isoMer.);3,7,11,15-Tetramethyl-2-hexadecene-1-ol | | CAS: | 7541-49-3 | | MF: | C20H40O | | MW: | 296.53 | | EINECS: | 616-221-6 | | Product Categories: | Acyclic;Alkenes;Building Blocks;Chemical Synthesis;Metabolic Pathways;Metabolomics;Organic Building Blocks;Terpenoid Metabolism;Terpenoids | | Mol File: | 7541-49-3.mol |  |
| | 3,7,11,15-TETRAMETHYL-2-HEXADECEN-1-OL Chemical Properties |
| Boiling point | 202-204 °C10 mm Hg(lit.) | | density | 0.85 g/mL at 25 °C(lit.) | | vapor pressure | 3hPa at 25℃ | | FEMA | 4196 | PHYTOL | | refractive index | n20/D 1.463(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | pka | 14.73±0.10(Predicted) | | form | Liquid | | Odor | at 100.00 %. mild light floral balsam green jasmin | | Odor Type | floral | | biological source | synthetic | | BRN | 1726098 | | Cosmetics Ingredients Functions | FRAGRANCE
PERFUMING
SKIN CONDITIONING - EMOLLIENT | | InChI | 1S/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+ | | InChIKey | BOTWFXYSPFMFNR-HMMYKYKNSA-N | | SMILES | CC(C)CCCC(C)CCCC(C)CCC\C(C)=C\CO | | LogP | 4.5 at 25℃ | | EPA Substance Registry System | 2-Hexadecen-1-ol, 3,7,11,15-tetramethyl- (7541-49-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29052900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 4
Skin Irrit. 2 |
| | 3,7,11,15-TETRAMETHYL-2-HEXADECEN-1-OL Usage And Synthesis |
| Chemical Properties | clear colourless to yellow liquid | | Uses | Phytol is a reagent that is used in the preparation of α-tocopherol analogs as mitochondrial antioxidants. | | General Description | Phytol is a diterpene alcohol and is widely used as a food additive and in medicinal field. It undergoes Mitsunobu reaction with 5-fluorouridine to yield the nucleoterpenes. | | Biochem/physiol Actions | Phytol exhibits potential anti-Schistosomal properties. It induces sedative and anxiolytic-like effects in mice. | | IC 50 | Human Endogenous Metabolite |
| | 3,7,11,15-TETRAMETHYL-2-HEXADECEN-1-OL Preparation Products And Raw materials |
|