|
|
| | Acrolein dimethyl acetal Basic information |
| Product Name: | Acrolein dimethyl acetal | | Synonyms: | Acroleindimethylacetal,99%;1,1-Dimethoxyprop-2-ene;2-Propenal, dimethyl acetal;3,3-Dimethoxyprop-1-ene;Acrylaldehyde dimethyl acetal;Propenal dimethyl acetal;Acrolein DiMethyl Acetal , 97.0%(GC);1-Propene, 3,3-dimethoxy- | | CAS: | 6044-68-4 | | MF: | C5H10O2 | | MW: | 102.13 | | EINECS: | 227-936-4 | | Product Categories: | Pharmaceutical Intermediates | | Mol File: | 6044-68-4.mol |  |
| | Acrolein dimethyl acetal Chemical Properties |
| Boiling point | 89-90 °C(lit.) | | density | 0.862 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.395(lit.) | | Fp | 27 °F | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 1700037 | | InChI | InChI=1S/C5H10O2/c1-4-5(6-2)7-3/h4-5H,1H2,2-3H3 | | InChIKey | OBWGMYALGNDUNM-UHFFFAOYSA-N | | SMILES | C=CC(OC)OC | | LogP | 0.653 (est) | | CAS DataBase Reference | 6044-68-4(CAS DataBase Reference) | | NIST Chemistry Reference | Acrolein,dimethyl acetal(6044-68-4) |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16-23-24/25-29-33 | | RIDADR | UN 3384 6.1/PG 1 | | WGK Germany | 3 | | RTECS | UC8500000 | | HazardClass | 3.1 | | PackingGroup | II | | HS Code | 2911000000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | Acrolein dimethyl acetal Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | Acrolein dimethyl acetal was used in the facile one step synthesis of 4-hydroxy-2E-nonenal and its dimethyl acetal via a cross-metathesis reaction with octen-3-ol. | | Purification Methods | Fractionally distil it (after adding 0.5g of hydroquinone) under reduced pressure through an all glass column (40cm x 2.5 cm) packed with glass helices and provided with a heated jacket and a total reflux variable take-off head. Stainless steel Lessing rings (1/8 x 1/8 in) or gauze have also been used as packing. It is a highly flammable and TOXIC liquid; keep away from the skin. [Hall & Stern J Chem Soc 2657 1955, Beilstein 1 IV 3437.] |
| | Acrolein dimethyl acetal Preparation Products And Raw materials |
|