| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Cytosine-2,4-13C2,15N3 CAS:285978-06-5 Purity:98 atom % 15N, 99 atom % 13C Package:10MG Remarks:492108-10MG
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:Cytosine-2,4-13C2,15N3 98 atom % 15N, 99 atom % 13C CAS:285978-06-5 Purity:NULL Package:10mg Remarks:NULL
|
| Company Name: |
Ningbo jinuo chemical co., LTD
|
| Tel: |
0574-87314919 057487319282 |
| Email: |
info@nbinno.com |
| Products Intro: |
Product Name:6-azanyl-1H-pyrimidin-2-one CAS:285978-06-5 Purity:99%
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Cytosine-2,4-13C2,15N3 CAS:285978-06-5
|
|
| | CYTOSINE-2,4-13C2-15N3 Basic information |
| Product Name: | CYTOSINE-2,4-13C2-15N3 | | Synonyms: | CYTOSINE-2,4-13C2-15N3;CYTOSINE-2,4-13C2-15N3, 99 ATOM % 13C, 9 9 ATOM % 15N;Cytosine-[13C2,15N3];Cytosine-2,4-13C2,15N3 98 atom % 15N, 99 atom % 13C;6-azanyl-1H-pyrimidin-2-one;Cytosine-[13C2, 15N3] (Standard) | | CAS: | 285978-06-5 | | MF: | C4H5N3O | | MW: | 116.15 | | EINECS: | | | Product Categories: | Alphabetical Listings;C;Stable Isotopes | | Mol File: | 285978-06-5.mol |  |
| | CYTOSINE-2,4-13C2-15N3 Chemical Properties |
| Melting point | >300 °C(lit.) | | form | solid | | InChI | 1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8)/i3+1,4+1,5+1,6+1,7+1 | | InChIKey | OPTASPLRGRRNAP-SLOBMOILSA-N | | SMILES | [15NH2][13C]1=[15N][13C](=O)[15NH]C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | CYTOSINE-2,4-13C2-15N3 Usage And Synthesis |
| Uses | Cytosine-13C2,15N3 is the labelled version of Cytosine (C998950(P)), which is one of the four main bases in DNA and RNA. The labelled version of Cytosine could be useful for biological studies that involve targeting cytosine free bases. |
| | CYTOSINE-2,4-13C2-15N3 Preparation Products And Raw materials |
|