| Company Name: |
SynThink RESEARCH CHEMICALS
|
| Tel: |
+91-8177860948 |
| Email: |
bd@synthinkchemicals.com |
| Products Intro: |
Product Name:Testosterone EP Impurity B
CAS:972-46-3
Purity:98% Package:25mg, 50mg,100mg,200mg
|
| Company Name: |
Jiangsu Jitai Peptide Technology Co., Ltd. Gold
|
| Tel: |
051580855088 18762539991 |
| Email: |
info@gtaipeptide.com |
| Products Intro: |
Product Name:3-Ethoxy-androsta-3,5-dien-17-one
CAS:972-46-3
Purity:98% HPLC Package:100g/1kg
|
|
| | 3-Ethoxy-androsta-3,5-dien-17-one Basic information |
| Product Name: | 3-Ethoxy-androsta-3,5-dien-17-one | | Synonyms: | 3-Ethoxy-androsta-3,5-dien-17-one;3-Ethoxyandrosta-3,5-dien-17-one;Androst-4-ene-3,17-dione 3-Ethyl Enol Ethe;Androst-4-ene-3,17-dione 3-Ethyl Enol Ether;3-Ethoxy-3,5-androstadien-17-one;(8R,9S,10R,13S,14S)-3-ethoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one;Testosterone BP Impurity B;3-Ethoxyandrosta-3,5-dien-17-one (A | | CAS: | 972-46-3 | | MF: | C21H30O2 | | MW: | 314.46 | | EINECS: | 619-264-9 | | Product Categories: | Steroids & Hormones - 13C & 2H;Steroids;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 972-46-3.mol |  |
| | 3-Ethoxy-androsta-3,5-dien-17-one Chemical Properties |
| Melting point | 167-169°C | | density | 1.16g/cm3 at 20℃ | | vapor pressure | 0-0Pa at 20-25℃ | | form | Solid:particulate/powder | | InChI | InChI=1S/C21H30O2/c1-4-23-15-9-11-20(2)14(13-15)5-6-16-17-7-8-19(22)21(17,3)12-10-18(16)20/h5,13,16-18H,4,6-12H2,1-3H3/t16-,17-,18-,20-,21-/m0/s1 | | InChIKey | PAOWPNQOTVTCAF-OEUJLIAZSA-N | | SMILES | C1(OCC)=CC2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)C(=O)CC3)CC=2 | | LogP | 6.4 at 20℃ |
| | 3-Ethoxy-androsta-3,5-dien-17-one Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Testosterone derivative |
| | 3-Ethoxy-androsta-3,5-dien-17-one Preparation Products And Raw materials |
|