- Closantel sodium
-
- $0.00 / 25Kg/Drum
-
2026-04-24
- CAS:61438-64-0
- Min. Order: 1KG
- Purity: 98%-102%;CPV
- Supply Ability: 1000 KG
- Closantel sodium
-
- $0.00 / 1kg
-
2026-04-24
- CAS:61438-64-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: Customise
|
| | Closantel sodium Basic information |
| | Closantel sodium Chemical Properties |
| Melting point | >230°C (dec.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to yellow | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C22H14Cl2I2N2O2.Na.H/c1-11-6-15(17(10-27)12-2-4-13(23)5-3-12)18(24)9-20(11)28-22(30)16-7-14(25)8-19(26)21(16)29;;/h2-9,17,29H,1H3,(H,28,30);; | | InChIKey | OEGFIKHJXKPQEL-UHFFFAOYSA-N | | SMILES | C(C1C=CC(Cl)=CC=1)(C1C=C(C)C(NC(C2C=C(I)C=C(I)C=2O)=O)=CC=1Cl)C#N.[NaH] | | CAS DataBase Reference | 61438-64-0(CAS DataBase Reference) |
| | Closantel sodium Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | As a broad-spectrum anthelmintic, Closantel sodium can be used against nematode infection. |
| | Closantel sodium Preparation Products And Raw materials |
|