(4-PHENOXYPHENYL)METHANOL manufacturers
|
| | (4-PHENOXYPHENYL)METHANOL Basic information |
| Product Name: | (4-PHENOXYPHENYL)METHANOL | | Synonyms: | (4-PHENOXYPHENYL)METHANOL;RARECHEM AL BD 0081;4-Phenoxybenzyl alcohol 97%;(4-Phenoxyphenyl)methanol, 4-(Hydroxymethyl)diphenyl ether;4-Phenoxybenzylalcohol97%;Benzenemethanol, 4-phenoxy-;(4-Phenoxyphenyl)methanol - [P89912] | | CAS: | 2215-78-3 | | MF: | C13H12O2 | | MW: | 200.23 | | EINECS: | | | Product Categories: | | | Mol File: | 2215-78-3.mol |  |
| | (4-PHENOXYPHENYL)METHANOL Chemical Properties |
| Melting point | 54.5-56°C | | Boiling point | 333.2±25.0 °C(Predicted) | | density | 1.151±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.36±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H12O2/c14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12/h1-9,14H,10H2 | | InChIKey | FEOMFFKZOZMBKD-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(OC2=CC=CC=C2)C=C1 |
| Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | WGK 3 | | HS Code | 2909498090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Sens. 1 |
| | (4-PHENOXYPHENYL)METHANOL Usage And Synthesis |
| Uses | (4-phenoxyphenyl)methanol is a useful reactant and reagent in organic reactions and synthesis. |
| | (4-PHENOXYPHENYL)METHANOL Preparation Products And Raw materials |
|