|
|
| | Methyl 3-amino-2-thiophenecarboxylate Basic information |
| | Methyl 3-amino-2-thiophenecarboxylate Chemical Properties |
| Melting point | 62-64 °C (lit.) | | Boiling point | 100-102 °C/0.1 mmHg (lit.) | | density | 1.274 (estimate) | | refractive index | 1.5500 (estimate) | | Fp | 100-102°C/0.1mm | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 1.86±0.10(Predicted) | | form | Fine Crystalline Powder | | color | Beige to beige-brown | | Water Solubility | Slightly soluble in water. | | BRN | 1365614 | | InChI | InChI=1S/C6H7NO2S/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,7H2,1H3 | | InChIKey | TWEQNZZOOFKOER-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)SC=CC=1N | | CAS DataBase Reference | 22288-78-4(CAS DataBase Reference) | | EPA Substance Registry System | 2-Thiophenecarboxylic acid, 3-amino-, methyl ester (22288-78-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36/37/39-22 | | WGK Germany | 3 | | RTECS | XM8347500 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Methyl 3-amino-2-thiophenecarboxylate Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | Methyl 3-amino-2-thiophenecarboxylate was used in:
- the synthesis of 4-nitro and 4-aminothienyl ureas
- total synthesis of quinazolinocarboline alkaloids
- preparation of thienopyrimidinone analogs
| | Uses | Methyl 3-amino-2-thiophenecarboxylate is the starting material for synthesising Belvarafenib. Belvarafenib is a small-molecule RAF dimer (type II) inhibitor with potential antitumour activity. | | General Description | Methyl 3-amino-2-thiophenecarboxylate reacts with hydrazonoyl chlorides in the presence of triethylamine to yield corresponding N-arylamidrazones. |
| | Methyl 3-amino-2-thiophenecarboxylate Preparation Products And Raw materials |
| Raw materials | Acrylonitrile-->Methyl thioglycolate-->1.3-Dichloropropene-->3-Chloroacrylonitrile-->3-Aminothiophene-2-carboxylic acid-->METHYL 3-OXOTETRAHYDROTHIOPHENE-2-CARBOXYLATE-->3-Pyridinecarboxaldehyde-->2-Chloroacrylonitrile | | Preparation Products | METHYL 3-CHLOROTHIOPHENE-2-CARBOXYLATE-->Methyl 3-aminosulfonylthiophene-2-carboxylate-->3-CHLOROTHIOPHENE-2-CARBOXAMIDE-->3-(1H-PYRROL-1-YL)THIOPHENE-2-CARBOXYLIC ACID-->METHYL 3-[(2-BROMOACETYL)AMINO]THIOPHENE-2-CARBOXYLATE-->2,4-DICHLOROTHIENO[3,2-D]PYRIMIDINE-->2,4-Dichlorothieno[3,2-d]pyrimidine-->3-(Acetylamino)thiophene-2-carboxylic acid-->2,4-DIHYDROXYTHIENO[3,2-D]PYRIMIDINE-->3-AMino-4-broMo-thiophene-2-carboxylicacidMethylester-->methyl 3-(phenylsulfonamido)thiophene-2-carboxylate-->2-Thiophenecarboxylic acid, 3-[[(5-bromo-2,3-dihydro-7-benzofuranyl)sulfonyl]amino]--->3,8-DIAZA-5-METHYLENE-6,12-DITHIATRICYCLO[7.3.0.0(3,7)]DODECA-1(9),7(8),10-TRIEN-2-ONE-->METHYL 3-(BENZOYLAMINO)-2-THIOPHENECARBOXYLATE |
|