|
|
| | 4-(TRIFLUOROMETHYL)MANDELIC ACID Basic information |
| | 4-(TRIFLUOROMETHYL)MANDELIC ACID Chemical Properties |
| Melting point | 130-134 °C | | Boiling point | 324.2±37.0 °C(Predicted) | | density | 1.3670 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 3.06±0.10(Predicted) | | Appearance | White to off-white Solid | | BRN | 2979949 | | InChI | 1S/C9H7F3O3/c10-9(11,12)6-3-1-5(2-4-6)7(13)8(14)15/h1-4,7,13H,(H,14,15) | | InChIKey | SDGXYUQKJPFLDG-UHFFFAOYSA-N | | SMILES | OC(C(O)=O)c1ccc(cc1)C(F)(F)F | | CAS DataBase Reference | 395-35-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29181990 | | Storage Class | 11 - Combustible Solids |
| | 4-(TRIFLUOROMETHYL)MANDELIC ACID Usage And Synthesis |
| Chemical Properties | white to almost white powder | | Uses | Bismuth-catalyzed oxidation of 4-(trifluoromethyl)mandelic acid has been reported. | | General Description | Bismuth-catalyzed oxidation of 4-(trifluoromethyl)mandelic acid has been reported. |
| | 4-(TRIFLUOROMETHYL)MANDELIC ACID Preparation Products And Raw materials |
|