|
|
| | 3-Bromo-2-fluorophenylacetonitrile Basic information |
| Product Name: | 3-Bromo-2-fluorophenylacetonitrile | | Synonyms: | 3-Bromo-2-fluorophenylacetonitrile;2-(3-broMo-2-fluoro-phenyl)acetonitrile;3-Bromo-2-fluorophenylacetonitrileSPHATE DISODIUM SALT MONOHYDRATE;Benzeneacetonitrile, 3-bromo-2-fluoro- | | CAS: | 874285-03-7 | | MF: | C8H5BrFN | | MW: | 214.03 | | EINECS: | | | Product Categories: | | | Mol File: | 874285-03-7.mol |  |
| | 3-Bromo-2-fluorophenylacetonitrile Chemical Properties |
| Boiling point | 92℃/0.3mm | | density | 1.589 g/mL at 25 °C | | refractive index | n20/D1.551 | | Fp | >110℃ | | storage temp. | Sealed in dry,Room Temperature | | form | fused solid | | color | White waxy | | InChI | InChI=1S/C8H5BrFN/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2 | | InChIKey | JKRBRQNAVKGEHZ-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC=CC(Br)=C1F |
| Hazard Codes | T,Xi | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3276 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | 6.1 | | HazardClass | IRRITANT | | HS Code | 2926907090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Bromo-2-fluorophenylacetonitrile Usage And Synthesis |
| | 3-Bromo-2-fluorophenylacetonitrile Preparation Products And Raw materials |
|