- Ganoderic acid B
-
- $73.00 / 1mg
-
2026-02-02
- CAS:81907-61-1
- Min. Order:
- Purity: 99.97%
- Supply Ability: 10g
- Ganoderic Acid B
-
- $0.00 / 25kg
-
2024-04-12
- CAS:81907-61-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 2000ton
- Ganoderic acid B
-
- $0.00 / 5mg
-
2023-02-24
- CAS:81907-61-1
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Ganoderic acid B Basic information |
| Product Name: | Ganoderic acid B | | Synonyms: | Aids070760;Aids-070760;Lanost-8-en-26-oic acid, 3,7-dihydroxy-3,11,23-trioxo-, (7.beta.,15.alpha.,25R)-;(3beta,7beta,25R)-3,7-Dihydroxy-11,15,23-trioxo-lanost-8-en-26-oic acid;Ganoderic acid B;(25R)-3β,7β-Dihydroxy-11,15,23-trioxo-5α-lanost-8-en-26-oic acid;(2R,6R)-6-((3S,5R,7S,10S,13R,14R,17R)-3,7-Dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxoheptanoic acid;(2R,6R)-6-[(3S,5R,7S,10S,13R,14R,17R)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxoheptanoic acid | | CAS: | 81907-61-1 | | MF: | C30H44O7 | | MW: | 516.67 | | EINECS: | | | Product Categories: | | | Mol File: | 81907-61-1.mol |  |
| | Ganoderic acid B Chemical Properties |
| Melting point | 219 - 222°C | | Boiling point | 689.0±55.0 °C(Predicted) | | density | 1.22 | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 4.77±0.23(Predicted) | | form | Solid | | color | White to Pale Yellow | | Water Solubility | insoluble in water | | InChIKey | LWPLEHFGBRFRKI-NBCWKOIPSA-N | | SMILES | O[C@@H]1C([C@H]2[C@](CC1)(C3=C([C@]4([C@@]([C@H](CC4=O)[C@@H](CC(=O)C[C@@H](C)C(=O)O)C)(CC3=O)C)C)[C@H](C2)O)C)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Ganoderic acid B Usage And Synthesis |
| Chemical Properties | White powder, soluble in organic solvents such as methanol, ethanol, and DMSO. It is derived from the dried fruiting body of Ganoderma lucidum (Leyss. exFr.) Karst. of the Polyporaceae family. | | Uses | Ganoderic Acid B, is a new lanostanoid triterpene extracted from the fruit bodies of Ganoderma Lucidum mushroom. these compounds are shown to possess many therapeutic properties. They can be used as anti-virus, anti-inflammation, anti-tumor, immunity-promoting, anti-diabetic, etc. | | Definition | ChEBI: Ganoderic acid B is a triterpenoid. | | target | JAK | STAT | IL Receptor | p38MAPK | NF-kB | HIV-1 |
| | Ganoderic acid B Preparation Products And Raw materials |
|