|
|
| | DECAMETHYLTETRASILOXANE Basic information |
| | DECAMETHYLTETRASILOXANE Chemical Properties |
| Melting point | -68 °C (lit.) | | Boiling point | 194 °C (lit.) | | density | 0.854 g/mL at 25 °C (lit.) | | vapor density | >1 (vs air) | | vapor pressure | 73Pa at 25℃ | | refractive index | n20/D 1.389(lit.) | | Fp | 144 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | <0.1mg/l | | form | liquid | | Specific Gravity | 0.854 | | color | Colourless to Pale Yellow | | Water Solubility | 6.74μg/L at 23℃ | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | Merck | 14,2850 | | BRN | 1776881 | | Henry's Law Constant | 1.4×10-7 mol/(m3Pa) at 25℃, Xu and Kropscott (2014) | | Dielectric constant | 2.4（20℃） | | Stability: | Moisture Sensitive | | Cosmetics Ingredients Functions | ANTIFOAMING | | InChI | 1S/C10H30O3Si4/c1-14(2,3)11-16(7,8)13-17(9,10)12-15(4,5)6/h1-10H3 | | InChIKey | YFCGDEUVHLPRCZ-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C | | LogP | 8.21 at 25.1℃ | | CAS DataBase Reference | 141-62-8(CAS DataBase Reference) | | NIST Chemistry Reference | Tetrasiloxane, decamethyl-(141-62-8) | | EPA Substance Registry System | Tetrasiloxane, decamethyl- (141-62-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 23-24/25-37/39-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | DECAMETHYLTETRASILOXANE Usage And Synthesis |
| Chemical Properties | Colorless or yellowish transparent liquid | | Uses | A non-cyclic silicone oligomer. Used in the methylation of mercury(II) salts. Study shows that it transformed by a specific microflora and in the natural environment degraded by mechanisms similar to other organic compounds. | | Uses | Decamethyltetrasiloxane can be used as a basis for silicone oils or fluids designed to withstand extremes of temp; as a foam suppressant in petroleum lubricating oil. | | Flammability and Explosibility | Flammable | | Toxics Screening Level | The ITSL for decamethyltetrasiloxane has been changed from 0.04 μg/m3 to 0.1 μg/m3 based on an annual averaging time. |
| | DECAMETHYLTETRASILOXANE Preparation Products And Raw materials |
|