| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | ZINC 2,9,16,23-TETRA-TERT-BUTYL-29 H,31 H-PHTHALOCYANINE Basic information |
| Product Name: | ZINC 2,9,16,23-TETRA-TERT-BUTYL-29 H,31 H-PHTHALOCYANINE | | Synonyms: | (TETRA-T-BUTYLPHTHALOCYANINATO)ZINC;ZINC 2,9,16,23-TETRA-TERT-BUTYL-29 H,31 H-PHTHALOCYANINE;zinc 2,9,16,23-tetra-tert-butyl-29H,31H-phthalocy;Zinc 2,9,16,23-tetra-tert-butyl-29H,31H-phthalocyanine Dye content ~96 %;Zinc(II)2,9,16,23-(tetra-t-butyl)phthalocyanine, 95%;2,9,16,23-Tetra-tert-butyl-29H,31H-zinc phthalocyanine;Zinc(II) 2,9,16,23-tetra-tert-butylphthalocyanine;Zinc 2,9,16,23-tetra-tert-butyl-29H,31H-phthalocyanine | | CAS: | 39001-65-5 | | MF: | C48H48N8Zn | | MW: | 802.34 | | EINECS: | | | Product Categories: | Infrared (IR) DyesPhotonic and Optical Materials;Organic Electronics and Photonics;Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;Phthalocyanines | | Mol File: | 39001-65-5.mol |  |
| | ZINC 2,9,16,23-TETRA-TERT-BUTYL-29 H,31 H-PHTHALOCYANINE Chemical Properties |
| Melting point | >300 °C (lit.) | | λmax | 677 nm | | InChIKey | XWOSAEWCOSVNDP-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1ccc2c3nc(nc4n5[Zn]n6c(nc7nc(nc5c8cc(ccc48)C(C)(C)C)c9ccc(cc79)C(C)(C)C)c%10ccc(cc%10c6n3)C(C)(C)C)c2c1 |
| WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 13 - Non Combustible Solids |
| | ZINC 2,9,16,23-TETRA-TERT-BUTYL-29 H,31 H-PHTHALOCYANINE Usage And Synthesis |
| | ZINC 2,9,16,23-TETRA-TERT-BUTYL-29 H,31 H-PHTHALOCYANINE Preparation Products And Raw materials |
|