- Jolkinolide B
-
- $60.00 / 1mg
-
2026-01-26
- CAS:37905-08-1
- Min. Order:
- Purity: 99.70%
- Supply Ability: 10g
- Jolkinolide B
-
- $0.00 / 20mg
-
2023-02-24
- CAS:37905-08-1
- Min. Order: 20mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | jolkinolide B Basic information |
| Product Name: | jolkinolide B | | Synonyms: | jolkinolide B;(4aR,6aS,7aβ,10aR)-1,2,3,4,4aα,5,6,11aβ,11bα,11c-Decahydro-4,4,8,11cβ-tetramethylbisoxireno[1,10a:3,4]phenanthro[3,2-b]furan-9(7aH)-one;1,4-dibutyl-N-(2,6-dimethylphenyl)piperazine-2-carboxamide,nitrous acid;Bisoxireno[1,10a:3,4]phenanthro[3,2-b]furan-9(7aH)-one, 1,2,3,4,4a,5,6,11a,11b,11c-decahydro-4,4,8,11c-tetramethyl-, (4aR,6aS,7aR,10aR,11aR,11bR,11cR)-;(4aR,6aS,7aR,10aR,11aR,11bR,11cR)-4,4,8,11c-tetramethyl-1,2,...;Ritacin P;Ritacin-P;Jolkinolide B, 10 mM in DMSO | | CAS: | 37905-08-1 | | MF: | C20H26O4 | | MW: | 330.42 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 37905-08-1.mol |  |
| | jolkinolide B Chemical Properties |
| Melting point | 213-215℃ | | Boiling point | 497.1±45.0 °C(Predicted) | | density | 1.28±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | -10 to -25°C | | solubility | DMSO: 2mg/mL, clear (Warmed) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C20H26O4/c1-10-12-14-19(22-14)9-6-11-17(2,3)7-5-8-18(11,4)13(19)15-20(12,23-15)24-16(10)21/h11,13-15H,5-9H2,1-4H3/t11-,13+,14-,15-,18-,19+,20-/m1/s1 | | InChIKey | SOVOCMGDFRGRKF-MCDHERAVSA-N | | SMILES | O1[C@@]32OC(=O)C(=C3[C@H]4O[C@]54[C@@H]([C@H]21)[C@]6([C@@H](C(CCC6)(C)C)CC5)C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | jolkinolide B Usage And Synthesis |
| Uses | Jolkinolide B, a bioactive diterpene isolated from the roots of Euphorbia fischeriana Steud, is known to induce apoptosis in cancer cells[1]. | | Definition | ChEBI: A natural product found in Euphorbia fischeriana. | | Biological Activity | Jolkinolide B is a diterpenoid isolated from the dried root of Euphorbia fischeriana steud th at exhibits anticancer, anti-inflammatory and immunomodulatory activities. Jolkinolide B induces apoptosis in numerous human cancer cell lines including breast cancer MDA-MB-231, MCF7, chronic myeloid leukemia K562, leukemic U937 and LNCaP cells. Apparently, it induces apoptosis in mouse melanoma B16F10 cells through downregulation of mRNA expression. | | References | [1] Wang, J., Zhou, Y., Bai, X. et al. Jolkinolide B from Euphorbia fischeriana Steud induces apoptosis in human leukemic U937 cells through PI3K/Akt and XIAP pathways. Mol Cells 32, 451–457 (2011). DOI:10.1007/s10059-011-0137-0 |
| | jolkinolide B Preparation Products And Raw materials |
|