|
|
| | corytuberine Basic information |
| Product Name: | corytuberine | | Synonyms: | (6aS)-2,10-Dimethoxy-6-methyl-5,6,6aα,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,11-diol;(6aS)-5,6,6a,7-Tetrahydro-2,10-dimethoxy-6-methyl-4H-dibenzo[de,g]quinoline-1,11-diol;2,10-Dimethoxy-6aα-aporphine-1,11-diol;4,5,6aα,7-Tetrahydro-2,10-dimethoxy-6-methyl-6H-dibenzo[de,g]quinoline-1,11-diol;1,11-Dihydroxy-2,10-diMethoxy-6aα-aporphine;2,10-Dimethoxy-6aalpha-aporphine-1,11-diol;4H-Dibenzo[de,g]quinoline-1,11-diol, 5,6,6a,7-tetrahydro-2,10-dimethoxy-6-methyl-, (6aS)-;(S)-Corytuberine | | CAS: | 517-56-6 | | MF: | C19H21NO4 | | MW: | 327.37 | | EINECS: | | | Product Categories: | Aromatics;Chiral Reagents;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;Alkaloids | | Mol File: | 517-56-6.mol |  |
| | corytuberine Chemical Properties |
| Melting point | 245℃ | | Boiling point | 529.3±50.0 °C(Predicted) | | density | 1.290±0.06 g/cm3 (20 ºC 760 Torr) | | form | Solid | | pka | 9.20±0.20(Predicted) | | InChI | InChI=1S/C19H21NO4/c1-20-7-6-11-9-14(24-3)19(22)17-15(11)12(20)8-10-4-5-13(23-2)18(21)16(10)17/h4-5,9,12,21-22H,6-8H2,1-3H3/t12-/m0/s1 | | InChIKey | WHFUDAOCYRYAKQ-LBPRGKRZSA-N | | SMILES | N1(C)[C@]2([H])C3=C(C(O)=C(OC)C=C3CC1)C1=C(O)C(OC)=CC=C1C2 |
| | corytuberine Usage And Synthesis |
| Chemical Properties | Off-white crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Dicranostigma, a plant of the genus Dicranostigma in the Papaveraceae family. | | Uses | Semi-synthetic aristolactams-inhibitor of CDK2 enzyme as antiproliferative agent. | | Definition | ChEBI: (S)-corytuberine is an aporphine alkaloid that is aporphine which is substituted by hydroxy groups at positions 1 and 11, and by methoxy groups at positions 2 and 10 (the S enantiomer). It has a role as a plant metabolite. It is an aporphine alkaloid, an organic heterotetracyclic compound, a tertiary amino compound, a polyphenol and an aromatic ether. |
| | corytuberine Preparation Products And Raw materials |
|