|
|
| | N-Fmoc-N-Methyl-O-tert-butyl-L-threonine Basic information |
| | N-Fmoc-N-Methyl-O-tert-butyl-L-threonine Chemical Properties |
| Melting point | 220-225°C | | Boiling point | 562.4±50.0 °C(Predicted) | | density | 1.185±0.06 g/cm3(Predicted) | | storage temp. | Store at +2°C to +8°C. | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.43±0.10(Predicted) | | form | Solid | | color | Off-white to light yellow | | Optical Rotation | [α]22/D +16.0°, c = 0.5% in methanol | | Major Application | peptide synthesis | | InChI | 1S/C24H29NO5/c1-15(30-24(2,3)4)21(22(26)27)25(5)23(28)29-14-20-18-12-8-6-10-16(18)17-11-7-9-13-19(17)20/h6-13,15,20-21H,14H2,1-5H3,(H,26,27)/t15-,21+/m1/s1 | | InChIKey | VIUVLZHFMIFLHU-FXMQYSIJSA-N | | SMILES | C(O)(=O)[C@H]([C@H](OC(C)(C)C)C)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C | | CAS DataBase Reference | 117106-20-4(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 13 - Non Combustible Solids |
| | N-Fmoc-N-Methyl-O-tert-butyl-L-threonine Usage And Synthesis |
| Chemical Properties | White to light yellow powder | | Uses | (2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-3-(tert-butoxy)butanoic Acid is a Threonine derivative that has been used for the preparation of antifungal cyclic depsipeptide petriellin . | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | N-Fmoc-N-Methyl-O-tert-butyl-L-threonine Preparation Products And Raw materials |
|