|
|
| | Benzidine dihydrochloride Basic information |
| Product Name: | Benzidine dihydrochloride | | Synonyms: | benzidine2hcl;P,P'-DIAMINOBIPHENYL DIHYDROCHLORIDE;4,4'-Diaminobiphenyl dihydrochloride;4,4′-Diaminodiphenyl dihydrochloride;[1,1'-biphenyl]-4,4'-diamine dihydrochloride;benzidinedihydrochloridehumancarcinogen;dihidroclorurodebenzidina;p,p’-Diaminodiphenylhydrochloride | | CAS: | 531-85-1 | | MF: | C12H13ClN2 | | MW: | 220.7 | | EINECS: | 208-519-6 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 531-85-1.mol |  |
| | Benzidine dihydrochloride Chemical Properties |
| Melting point | ≥300 °C | | form | powder | | color | Leaflets | | Water Solubility | 0.1-0.5 g/100 mL at 23.5 ºC | | BRN | 3914846 | | InChI | InChI=1S/C12H12N2.ClH/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;/h1-8H,13-14H2;1H | | InChIKey | FYRTZXXTIDKEJD-UHFFFAOYSA-N | | SMILES | NC1C=CC(C2C=CC(N)=CC=2)=CC=1.Cl | | CAS DataBase Reference | 531-85-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzidine dihydrochloride (531-85-1) |
| | Benzidine dihydrochloride Usage And Synthesis |
| Uses | The dihydrochlorie salt of Benzidine (B121000) a common used in dyes and environmental testing. | | General Description | White crystalline powder. | | Air & Water Reactions | Benzidine dihydrochloride may be sensitive to prolonged exposure to light and air. Slightly soluble in water. | | Reactivity Profile | Acidic organic/inorganic salts, such as Benzidine dihydrochloride, are generally soluble in water. The resulting solutions contain moderate to high concentrations of hydrogen ions and have pH's of less than 7.0. They react as acids to neutralize bases. These neutralizations generate heat, but less or far less than is generated by neutralization of inorganic acids, inorganic oxoacids, and carboxylic acid. They usually do not react as either oxidizing agents or reducing agents but such behavior is not impossible. Many of these compounds catalyze organic reactions. | | Fire Hazard | Flash point data for Benzidine dihydrochloride are not available; however, Benzidine dihydrochloride is probably combustible. | | Biological Activity | Tumor initiator in mammary glands of experimental animal. | | Safety Profile | Suspected carcinogen
with experimental carcinogenic and
tumorigenic data. Human mutation data
reported. When heated to decomposition it
emits very toxic fumes of HCl and NOx. | | Purification Methods | Benzidine dihydrochloride [531-85-1] M 257.2, m >250o(dec). Crystallise the salt by dissolving in hot H2O, and adding conc HCl to the slightly cooled solution. CARCINOGENIC.[Beilstein 13 IV 365.] |
| | Benzidine dihydrochloride Preparation Products And Raw materials |
|