6-hydroxydexamethasone manufacturers
|
| | 6-hydroxydexamethasone Basic information |
| Product Name: | 6-hydroxydexamethasone | | Synonyms: | 6-hydroxydexamethasone;Dexamethasone 6β-Hydroxy Impurity;Dexamethasone Impurity 12;6-Hydroxydexamethasone Solution, 100ppm;(6R,8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-6,11,17-trihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one;Dexamethasone 6beta-Hydroxy Impurity;6β-hydroxy Dexamethasone | | CAS: | 55879-47-5 | | MF: | C22H29FO6 | | MW: | 408.46 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals;Steroids | | Mol File: | 55879-47-5.mol |  |
| | 6-hydroxydexamethasone Chemical Properties |
| Melting point | 259-262°C | | Boiling point | 613.2±55.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Dioxane (Very Slightly, Sonicated), Methanol (Slightly) | | form | Solid | | pka | 12.06±0.70(Predicted) | | color | White to Light Yellow | | InChIKey | RVBSTEHLLHXILB-QIKGXCFKNA-N | | SMILES | C1[C@]2(C)[C@]3(F)[C@@H](O)C[C@]4(C)[C@](O)(C(CO)=O)[C@@H](C)C[C@@H]4[C@@H]3C[C@@H](O)C2=CC(=O)C=1 |&1:1,3,5,8,10,16,19,20,22,r| |
| | 6-hydroxydexamethasone Usage And Synthesis |
| Description | 6β-hydroxy Dexamethasone is a metabolite of dexamethasone (Item Nos. 11015 | 20340) that is more hydrophilic than the parent compound. Dexamethasone is metabolized by CYP3A4; therefore, quantification of the dexamethasone metabolites, 6α- and 6β-hydroxy dexamethasone, can be used to determine CYP3A4 enzyme activity in humans. The formation of 6-hydroxy dexamethasone metabolites is species-specific, with hamsters producing the highest amount. In rats, dexamethasone hydroxylation is sex-specific, with male rats producing metabolites in similar ratios to humans and female rats producing fewer hydroxylated metabolites than male rats. | | Chemical Properties | Off-White Solid | | Uses | The hydrophilic metabolite of Dexamethasone (D298800). | | References | [1] D M GENTILE. Dexamethasone metabolism by human liver in vitro. Metabolite identification and inhibition of 6-hydroxylation.[J]. Journal of Pharmacology and Experimental Therapeutics, 1996, 277 1: 105-112.
[2] JAMES C. RITCHIE . Preliminary studies of 6β-hydroxydexamethasone and its importance in the DST[J]. Biological Psychiatry, 1992, 32 9: Pages 825-833. DOI: 10.1016/0006-3223(92)90086-f |
| | 6-hydroxydexamethasone Preparation Products And Raw materials |
|