- Boc-L-Lys(Boc)-OSu
-
- $0.00/ kg
-
2026-02-02
- CAS:30189-36-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | N,N'-Di-Boc-L-lysine hydroxysuccinimide ester Basic information |
| | N,N'-Di-Boc-L-lysine hydroxysuccinimide ester Chemical Properties |
| Melting point | 184℃ | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), DMF (Slightly), DMSO (Slightly) | | pka | 10.76±0.46(Predicted) | | form | Powder | | color | Off-white | | Optical Rotation | [α]20/D 25.5±1.5°, c = 1% in DMF | | Water Solubility | Slightly soluble in water. | | Sensitive | Moisture Sensitive | | BRN | 1559007 | | Stability: | Hygroscopic | | Major Application | peptide synthesis | | InChI | InChI=1S/C20H33N3O8/c1-19(2,3)29-17(27)21-12-8-7-9-13(22-18(28)30-20(4,5)6)16(26)31-23-14(24)10-11-15(23)25/h13H,7-12H2,1-6H3,(H,21,27)(H,22,28)/t13-/m0/s1 | | InChIKey | IQVLXQGNLCPZCL-ZDUSSCGKSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)[C@H](CCCCNC(OC(C)(C)C)=O)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 30189-36-7(CAS DataBase Reference) |
| WGK Germany | 3 | | F | 10-21 | | HS Code | 29224190 | | Storage Class | 11 - Combustible Solids |
| | N,N'-Di-Boc-L-lysine hydroxysuccinimide ester Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Nalpha, Nepsilon-Di-Boc-L-lysine N-succinimidyl ester is used as a local anesthetic. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N,N'-Di-Boc-L-lysine hydroxysuccinimide ester Preparation Products And Raw materials |
|