|
|
| | 5'-Chloro-2(2',4'-dichlorophenyl)-2'-hydroxy-4'-methyl acetophenone Basic information |
| | 5'-Chloro-2(2',4'-dichlorophenyl)-2'-hydroxy-4'-methyl acetophenone Chemical Properties |
| Melting point | 158-161°C | | form | solid | | InChI | 1S/C15H11Cl3O2/c1-8-4-14(19)11(7-12(8)17)15(20)5-9-2-3-10(16)6-13(9)18/h2-4,6-7,19H,5H2,1H3 | | InChIKey | WUNHWDCMMVSCDG-UHFFFAOYSA-N | | SMILES | Cc1cc(O)c(cc1Cl)C(=O)Cc2ccc(Cl)cc2Cl |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-36-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 5'-Chloro-2(2',4'-dichlorophenyl)-2'-hydroxy-4'-methyl acetophenone Usage And Synthesis |
| | 5'-Chloro-2(2',4'-dichlorophenyl)-2'-hydroxy-4'-methyl acetophenone Preparation Products And Raw materials |
|